![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| iBoy/ | 2020-12-09 13:52 | - | |
| hit the beat/ | 2020-12-09 13:49 | - | |
| Zombies Have Fallen/ | 2020-12-09 20:24 | - | |
| Zero 3/ | 2022-01-04 20:39 | - | |
| You Cant Have It/ | 2020-12-09 20:24 | - | |
| XX[HD 720p]/ | 2022-01-04 20:39 | - | |
| Wtf!/ | 2020-12-09 20:24 | - | |
| Wonder Woman/ | 2020-12-09 20:24 | - | |
| Wolf Warriors 2/ | 2022-01-04 20:39 | - | |
| With Open Arms/ | 2020-12-09 20:23 | - | |
| Wish Upon/ | 2022-01-04 20:39 | - | |
| Winter War/ | 2020-12-09 20:23 | - | |
| Wind River/ | 2020-12-09 20:22 | - | |
| Win It All/ | 2022-01-04 20:39 | - | |
| Wilson/ | 2021-03-24 22:26 | - | |
| Wheelman/ | 2020-12-09 20:22 | - | |
| Wheeler/ | 2020-12-09 20:10 | - | |
| What Happened to Mon..> | 2020-12-09 20:09 | - | |
| Western World/ | 2019-03-21 18:14 | - | |
| We Dont Belong Here/ | 2020-12-09 20:09 | - | |
| War for the Planet o..> | 2021-06-05 05:51 | - | |
| Walking Out/ | 2020-12-09 20:09 | - | |
| Wake the Dead/ | 2020-12-09 20:09 | - | |
| WOLF WARRIORS/ | 2020-12-09 20:23 | - | |
| VooDoo/ | 2020-12-09 20:05 | - | |
| Voice from the Stone/ | 2020-12-09 20:05 | - | |
| Valley of Ditches/ | 2020-12-09 20:05 | - | |
| Valerian.and.the.Cit..> | 2020-12-09 20:05 | - | |
| Unforgettable/ | 2022-01-04 20:38 | - | |
| Une mère manipulatr..> | 2020-12-09 20:03 | - | |
| Unacknowledged/ | 2022-01-04 20:38 | - | |
| Tyler Perrys Madea ..> | 2020-12-09 20:03 | - | |
| Tulip Fever/ | 2020-12-09 20:03 | - | |
| Troy The Odyssey/ | 2020-12-09 20:02 | - | |
| Trinity Seven the Mo..> | 2022-01-04 20:38 | - | |
| Trauma 2017/ | 2020-12-09 20:02 | - | |
| Transformers The Las..> | 2020-12-09 20:01 | - | |
| Toxic Shark/ | 2022-01-04 20:38 | - | |
| Tour de Pharmacy/ | 2021-08-15 23:29 | - | |
| To the Bone/ | 2022-01-04 20:37 | - | |
| Top Coat Cash/ | 2019-03-21 18:08 | - | |
| Tom and Jerry- Willy..> | 2020-12-09 20:00 | - | |
| Tiny House of Terror/ | 2020-12-09 20:00 | - | |
| Thor Ragnarok/ | 2020-12-09 19:57 | - | |
| Thong Dee Fun/ | 2020-12-09 19:52 | - | |
| This Is Our Land/ | 2021-03-19 19:17 | - | |
| This Is Everything_ ..> | 2021-01-03 11:24 | - | |
| The startup Accendi ..> | 2020-12-09 17:04 | - | |
| The Zookeepers Wife/ | 2022-01-04 20:37 | - | |
| The Wrong Neighbor/ | 2020-12-09 17:53 | - | |
| The Wrong Mother/ | 2020-12-09 17:40 | - | |
| The Wrong Crush/ | 2020-12-09 17:26 | - | |
| The Wizard of Lies/ | 2020-12-31 20:55 | - | |
| The Wilde Wedding/ | 2020-12-09 17:13 | - | |
| The Wake/ | 2020-12-09 17:09 | - | |
| The Vault/ | 2022-01-04 20:40 | - | |
| The Turnaround/ | 2020-12-09 17:07 | - | |
| The Summoning/ | 2020-12-09 17:06 | - | |
| The Student/ | 2020-12-09 17:06 | - | |
| The Sound/ | 2021-05-27 11:54 | - | |
| The Son of Bigfoot/ | 2020-12-09 17:02 | - | |
| The Snowman/ | 2020-12-09 17:01 | - | |
| The Snare/ | 2020-12-09 17:01 | - | |
| The Show/ | 2020-12-09 16:58 | - | |
| The Shape of Water/ | 2020-12-09 16:45 | - | |
| The Shadow People/ | 2020-12-09 16:44 | - | |
| The Shadow Effect/ | 2020-12-09 16:44 | - | |
| The Shack/ | 2020-12-09 16:44 | - | |
| The Sex Trip/ | 2020-12-09 16:44 | - | |
| The Sex Addict/ | 2020-12-09 16:43 | - | |
| The Sense of an Ending/ | 2022-01-04 20:36 | - | |
| The Saint/ | 2020-12-09 16:43 | - | |
| The Rizen/ | 2020-12-09 16:43 | - | |
| The Return/ | 2021-04-11 23:11 | - | |
| The Raking/ | 2021-05-29 19:08 | - | |
| The Perfect Soulmate/ | 2020-12-09 16:42 | - | |
| The Perfect Catch/ | 2020-12-09 16:42 | - | |
| The Outcasts/ | 2020-12-09 16:42 | - | |
| The Other Side of Hope/ | 2021-07-25 11:44 | - | |
| The Only Living Boy ..> | 2022-01-04 20:36 | - | |
| The Mummy/ | 2020-12-09 16:40 | - | |
| The Mountain Between..> | 2020-12-09 16:40 | - | |
| The Monster Project/ | 2020-12-09 16:39 | - | |
| The Midwife/ | 2020-12-09 16:39 | - | |
| The Marker/ | 2022-01-04 20:36 | - | |
| The Marine 5- Battle..> | 2020-12-09 20:48 | - | |
| The Man Who Invented..> | 2022-01-04 20:35 | - | |
| The Lovers/ | 2020-12-09 16:34 | - | |
| The Liberator/ | 2021-01-04 00:45 | - | |
| The Last Scout/ | 2022-01-04 20:40 | - | |
| The LEGO Ninjago Movie/ | 2021-06-01 16:55 | - | |
| The Kings of Special..> | 2020-12-09 16:32 | - | |
| The Jungle Bunch/ | 2021-08-07 01:02 | - | |
| The Joneses Unplugged/ | 2020-12-09 16:31 | - | |
| The Jetsons/ | 2020-12-09 16:31 | - | |
| The Institute/ | 2020-12-09 16:31 | - | |
| The Incredible Jessi..> | 2021-03-25 16:52 | - | |
| The Immortal Life of..> | 2021-07-22 12:32 | - | |
| The Ice Cream Truck/ | 2020-12-09 16:31 | - | |
| The Houses October B..> | 2022-01-04 20:35 | - | |
| The Honor Farm/ | 2020-12-09 16:30 | - | |
| The Holly Kane Exper..> | 2020-12-09 16:30 | - | |
| The Hippopotamus/ | 2022-01-04 20:35 | - | |
| The Heyday of the In..> | 2020-12-09 16:29 | - | |
| The Hatton Garden Job/ | 2022-01-04 20:35 | - | |
| The Hatred/ | 2020-12-09 16:20 | - | |
| The Gracefield Incid..> | 2021-03-18 17:22 | - | |
| The Good Nanny/ | 2020-12-09 16:19 | - | |
| The Good Catholic/ | 2022-01-04 20:34 | - | |
| The Golden Monk/ | 2020-12-09 16:19 | - | |
| The Foreigner/ | 2020-12-09 16:18 | - | |
| The Fast and the Fie..> | 2020-12-09 16:18 | - | |
| The Farthest/ | 2021-01-28 17:29 | - | |
| The Evil Within/ | 2022-01-04 20:34 | - | |
| The Evangelist/ | 2022-01-04 20:34 | - | |
| The Emoji Movie/ | 2021-05-05 15:48 | - | |
| The Domicile/ | 2020-12-09 16:17 | - | |
| The Discovery/ | 2020-12-09 16:17 | - | |
| The Dinner/ | 2022-01-04 20:34 | - | |
| The Detained/ | 2020-12-09 16:16 | - | |
| The Dark Tower/ | 2020-12-09 16:12 | - | |
| The Dark Tapes/ | 2022-01-04 20:34 | - | |
| The Crucifixion/ | 2022-01-04 20:33 | - | |
| The Cropsey Incident/ | 2020-12-09 16:11 | - | |
| The Crazy Kelp/ | 2022-01-04 20:33 | - | |
| The Crash/ | 2022-01-04 20:33 | - | |
| The Covenant/ | 2020-12-09 16:10 | - | |
| The Case for Christ/ | 2022-01-04 20:33 | - | |
| The Bye Bye Man/ | 2022-01-04 20:33 | - | |
| The Bride/ | 2020-12-09 16:09 | - | |
| The Book of Henry/ | 2020-12-09 16:09 | - | |
| The Birthday Wish/ | 2020-12-09 16:08 | - | |
| The Bigfoot Project/ | 2020-12-09 16:07 | - | |
| The Big Sick/ | 2020-12-09 16:07 | - | |
| The Battleship Island/ | 2020-12-09 16:07 | - | |
| The Bar/ | 2021-05-09 12:54 | - | |
| The Babysitter/ | 2021-07-30 17:15 | - | |
| The Babymoon/ | 2020-12-09 15:53 | - | |
| The Avenue/ | 2020-12-09 15:53 | - | |
| The Atoning/ | 2020-12-09 15:52 | - | |
| The Art of Us/ | 2020-12-09 15:52 | - | |
| The Age of Spin- Dav..> | 2022-01-04 20:33 | - | |
| The Adventurers/ | 2020-12-21 22:49 | - | |
| The Abduction of Jen..> | 2021-02-07 23:19 | - | |
| The 74th Golden Glob..> | 2020-12-09 15:51 | - | |
| The.Wicked.One/ | 2020-12-09 19:42 | - | |
| The.Wall/ | 2020-12-09 19:41 | - | |
| The.Post/ | 2022-01-04 20:37 | - | |
| The.Hitmans.Bodyguard/ | 2020-12-09 18:57 | - | |
| The.Glass.Castle/ | 2021-03-24 22:37 | - | |
| The.Gaelic.King/ | 2020-12-09 20:49 | - | |
| Temple/ | 2021-03-18 16:33 | - | |
| Teleios/ | 2020-12-09 15:50 | - | |
| Teen Titans- The Jud..> | 2020-12-09 15:50 | - | |
| Tangled- Before Ever..> | 2020-12-09 15:50 | - | |
| Taking Earth/ | 2020-12-09 15:50 | - | |
| Taken Heart/ | 2020-12-09 15:50 | - | |
| Take Me/ | 2020-12-09 15:50 | - | |
| Tad Jones and the Se..> | 2020-12-09 15:49 | - | |
| Table 19/ | 2020-12-09 15:49 | - | |
| T2 Trainspotting/ | 2022-01-04 20:32 | - | |
| Surfs Up 2- WaveMania/ | 2021-05-09 10:48 | - | |
| Super Dark Times/ | 2022-01-04 20:32 | - | |
| Strip Club Massacre/ | 2020-12-09 15:49 | - | |
| Stratton/ | 2021-01-26 00:20 | - | |
| Storozhova Zastava a..> | 2020-12-09 15:49 | - | |
| Stasis/ | 2020-12-09 15:48 | - | |
| Star.Raiders.The.Adv..> | 2022-01-04 20:32 | - | |
| Stalkers Prey/ | 2022-01-04 20:32 | - | |
| Spyder/ | 2020-12-09 15:48 | - | |
| Spider-Man- Homecoming/ | 2020-12-09 15:48 | - | |
| Speech & Debate/ | 2020-12-09 15:47 | - | |
| Souleater/ | 2020-12-09 15:47 | - | |
| Song to Song/ | 2020-12-09 15:47 | - | |
| Soccer Killer/ | 2021-06-06 00:28 | - | |
| Sniper- Ultimate Kill/ | 2020-12-09 15:46 | - | |
| Smurfs- The Lost Vil..> | 2020-12-09 15:46 | - | |
| Smartass/ | 2020-12-09 15:46 | - | |
| Small Crimes/ | 2020-12-09 15:43 | - | |
| Sleepless[HD TSrip]/ | 2020-12-09 15:42 | - | |
| Slamma Jamma/ | 2020-12-09 15:42 | - | |
| Sky Hunter/ | 2020-12-09 15:42 | - | |
| Six Hot Chicks in a ..> | 2020-12-09 15:42 | - | |
| Singularity/ | 2022-01-04 20:31 | - | |
| Si jétais un homme/ | 2022-01-04 20:31 | - | |
| Sick of it All/ | 2021-03-24 01:50 | - | |
| Shot Caller/ | 2021-02-04 21:52 | - | |
| Shock Wave/ | 2020-12-09 15:40 | - | |
| Shimmer Lake/ | 2020-12-09 15:40 | - | |
| Sharknado.5.Global.S..> | 2021-03-05 23:20 | - | |
| Selfie/ | 2020-12-09 15:40 | - | |
| Security/ | 2022-01-04 20:31 | - | |
| Secrets of Deception/ | 2020-12-09 15:40 | - | |
| Scramble/ | 2020-12-09 15:39 | - | |
| Scooby-Doo! Shaggy's..> | 2022-01-04 20:31 | - | |
| Scarecrows/ | 2020-12-09 15:39 | - | |
| Scales- Mermaids Are..> | 2020-12-09 15:38 | - | |
| Saving Banksy/ | 2021-01-18 22:50 | - | |
| Savage Dog/ | 2022-01-04 20:31 | - | |
| Sandy Wexler/ | 2022-01-04 20:30 | - | |
| Sahara/ | 2020-12-09 15:37 | - | |
| Sacrilege/ | 2020-12-09 15:37 | - | |
| SPY GIRLS/ | 2020-12-09 15:48 | - | |
| SPF-18/ | 2020-12-09 15:47 | - | |
| Russell Peters- Almo..> | 2021-03-18 16:31 | - | |
| Running Wild/ | 2020-12-09 15:37 | - | |
| Rufus-2/ | 2022-01-04 20:30 | - | |
| Rogue.Warrior.Robot...> | 2020-12-09 15:36 | - | |
| Robo-Dog- Airborne/ | 2020-12-09 15:36 | - | |
| Ritter Rost 2- Das S..> | 2021-02-03 11:51 | - | |
| Rise of the Footsold..> | 2020-12-09 15:36 | - | |
| Rings/ | 2022-01-04 20:30 | - | |
| Revolt/ | 2020-12-09 15:36 | - | |
| Residue/ | 2020-12-09 15:35 | - | |
| Rebel in the Rye/ | 2022-01-04 20:30 | - | |
| Realm Of The Damned/ | 2020-12-09 15:33 | - | |
| Ravenswood/ | 2020-12-09 15:33 | - | |
| Random Tropical Para..> | 2020-12-09 15:33 | - | |
| Pussy Kills/ | 2020-12-09 15:33 | - | |
| Psychos/ | 2020-12-09 15:33 | - | |
| Pray for Rain/ | 2020-12-09 15:32 | - | |
| Pork Pie/ | 2020-12-09 15:32 | - | |
| Police Gang/ | 2020-12-09 15:32 | - | |
| Planning of be in Love/ | 2020-12-09 15:32 | - | |
| Planet Of Avatar/ | 2020-12-09 15:32 | - | |
| Pitching Tents/ | 2020-12-09 15:31 | - | |
| Pirates of the Carib..> | 2022-08-10 05:28 | - | |
| Pirates of the Carib..> | 2020-12-09 15:31 | - | |
| Pilgrimage/ | 2020-12-09 15:31 | - | |
| Picture of Beauty/ | 2020-12-09 15:30 | - | |
| Person to Person/ | 2021-03-18 21:33 | - | |
| Part-time Spy/ | 2019-03-21 17:41 | - | |
| OtherLife/ | 2022-01-04 20:29 | - | |
| Orbiter 9/ | 2020-12-09 15:27 | - | |
| Operation Dunkirk/ | 2020-12-09 15:27 | - | |
| Open Water 3/ | 2020-12-09 15:27 | - | |
| Open Marriage/ | 2020-12-09 20:33 | - | |
| One of us/ | 2020-12-09 15:27 | - | |
| One Under the Sun/ | 2020-12-31 16:19 | - | |
| Once Upon a Time/ | 2020-12-09 15:27 | - | |
| Oklahoma City/ | 2022-01-04 20:29 | - | |
| Off the Rails/ | 2020-12-09 15:26 | - | |
| Oceans Rising/ | 2020-12-09 15:26 | - | |
| Nove lune e mezza/ | 2020-12-09 15:25 | - | |
| Nightworld/ | 2021-02-02 18:48 | - | |
| Never Hike Alone/ | 2020-12-09 15:24 | - | |
| Never Here/ | 2022-01-04 20:29 | - | |
| Negative/ | 2020-12-09 15:24 | - | |
| Needlestick/ | 2020-12-09 15:16 | - | |
| Nanny Seduction/ | 2021-05-18 20:23 | - | |
| Naked/ | 2021-02-03 16:03 | - | |
| Nails/ | 2022-01-04 20:29 | - | |
| NOVEMBER CRIMINALS/ | 2020-12-09 15:26 | - | |
| My Uncles Wife/ | 2020-12-09 15:15 | - | |
| My Skinny Sister/ | 2021-05-05 02:56 | - | |
| My Pet Dinosaur/ | 2020-12-09 15:15 | - | |
| My Name Is Lenny/ | 2020-12-09 15:07 | - | |
| My Cousin Rachel/ | 2020-12-09 15:07 | - | |
| Murdered for Being D..> | 2020-12-09 15:07 | - | |
| Murder.on.the.Orient..> | 2020-12-09 15:06 | - | |
| Murder, She Baked- J..> | 2022-01-04 20:28 | - | |
| Moontrap/ | 2020-12-09 15:06 | - | |
| Moonlight in Vermont/ | 2020-12-09 15:05 | - | |
| Monumental/ | 2020-12-09 15:05 | - | |
| Monster X/ | 2020-12-09 15:05 | - | |
| Monster Trucks/ | 2022-01-04 20:28 | - | |
| Monster High/ | 2021-01-04 00:42 | - | |
| Mommy Dead and Dearest/ | 2022-01-04 20:28 | - | |
| Mommy, I Didnt Do It/ | 2022-01-04 20:28 | - | |
| Mommy's Little Boy/ | 2020-12-09 15:04 | - | |
| Mister Felicità/ | 2020-12-09 15:04 | - | |
| Mike Birbiglia/ | 2022-01-04 20:28 | - | |
| Mercenaries Lady Exp..> | 2020-12-09 15:04 | - | |
| Memoirs.of.a.Murderer/ | 2020-12-09 15:03 | - | |
| Max Payne- Retribution/ | 2020-12-09 15:03 | - | |
| Max 2- White House H..> | 2020-12-09 15:03 | - | |
| Mary Kills People/ | 2020-12-09 15:02 | - | |
| Marvels.Inhumans/ | 2019-03-21 17:34 | - | |
| Maria Bamford- Old B..> | 2021-02-12 17:07 | - | |
| Manny Dearest/ | 2020-12-09 15:02 | - | |
| Maigret- Night at th..> | 2020-12-09 15:02 | - | |
| Mad Families/ | 2020-12-09 15:02 | - | |
| Machine/ | 2020-12-09 15:02 | - | |
| Lucid Dream/ | 2022-01-04 20:28 | - | |
| Love on Ice/ | 2020-12-09 15:01 | - | |
| Love of My Life/ | 2020-12-09 15:01 | - | |
| Love at First Bark/ | 2021-01-12 20:53 | - | |
| Love Blossoms/ | 2020-12-09 15:01 | - | |
| Lost in the pacific/ | 2020-12-09 15:01 | - | |
| Lost in Florence/ | 2020-12-09 15:01 | - | |
| Lost Cat Corona/ | 2022-01-04 20:27 | - | |
| London Heist/ | 2020-12-09 15:00 | - | |
| Logan/ | 2019-03-21 17:29 | - | |
| Logan.Lucky/ | 2022-01-04 20:27 | - | |
| Locked Up/ | 2020-12-09 14:59 | - | |
| Locked In/ | 2022-01-04 20:27 | - | |
| Little Evil/ | 2020-12-09 14:59 | - | |
| Little Birds Big Adv..> | 2020-12-09 14:59 | - | |
| Like Cats/ | 2020-12-09 14:59 | - | |
| Life/ | 2020-12-09 14:59 | - | |
| Lemon/ | 2021-04-05 22:11 | - | |
| Lego DC Super Hero G..> | 2020-12-09 14:58 | - | |
| Legion of Brothers/ | 2021-05-09 03:53 | - | |
| Legend Of the Naga P..> | 2021-06-27 19:46 | - | |
| Legend Of The Naked ..> | 2020-12-09 14:57 | - | |
| Legend.of.the.Demon...> | 2020-12-09 14:58 | - | |
| Leatherface/ | 2020-12-09 14:56 | - | |
| Law of the Land/ | 2020-12-09 14:56 | - | |
| Last Rampage- The Es..> | 2020-12-09 14:55 | - | |
| Last.Flag.Flying/ | 2020-12-09 14:56 | - | |
| Larceny/ | 2020-12-09 20:29 | - | |
| Land of Smiles/ | 2022-01-04 20:27 | - | |
| Lady Expendables/ | 2020-12-09 14:54 | - | |
| Kuudes kert/ | 2020-12-09 14:54 | - | |
| Kuso/ | 2021-04-07 20:06 | - | |
| Kong Skull Island/ | 2020-12-09 14:54 | - | |
| Knights of the Damned/ | 2020-12-09 14:54 | - | |
| Kiss and Kil/ | 2020-12-09 14:53 | - | |
| Kingsman The Golden ..> | 2020-12-09 14:45 | - | |
| King Aurthur/ | 2020-12-09 14:16 | - | |
| Killing Gunther/ | 2022-01-04 20:26 | - | |
| Killer Mom/ | 2020-12-09 14:06 | - | |
| Killer App/ | 2022-01-04 20:26 | - | |
| Killem All/ | 2022-01-04 20:26 | - | |
| Kill Switch/ | 2022-01-04 20:26 | - | |
| Kidnap/ | 2021-04-01 11:09 | - | |
| Kickboxer Retaliatio..> | 2022-01-04 20:26 | - | |
| Khali the Killer/ | 2022-01-04 20:26 | - | |
| Justice League/ | 2020-12-09 14:02 | - | |
| Jungle/ | 2020-12-09 14:01 | - | |
| Jumanji Welcome to t..> | 2020-12-09 14:00 | - | |
| Journey to the West 2/ | 2020-12-09 14:00 | - | |
| Jonnys Sweet Revenge/ | 2019-03-21 17:19 | - | |
| John Wick Chapter 2[..> | 2020-12-09 13:59 | - | |
| Jigsaw/ | 2020-12-09 13:59 | - | |
| Jerrod Carmichael- 8/ | 2020-12-09 13:59 | - | |
| Jeepers Creepers III/ | 2020-12-09 13:58 | - | |
| Jasper Jones/ | 2021-06-25 19:57 | - | |
| Jackals/ | 2022-01-04 20:26 | - | |
| Its Not My Fault and..> | 2019-03-21 17:17 | - | |
| Its Gawd!/ | 2020-12-09 13:58 | - | |
| It Was Fifty Years A..> | 2021-06-08 15:22 | - | |
| It/ | 2020-12-09 13:57 | - | |
| It.Comes.at.Night/ | 2022-01-04 20:25 | - | |
| Is Genesis History/ | 2022-01-04 20:25 | - | |
| Instrument of War/ | 2020-12-09 13:56 | - | |
| Inconceivable/ | 2022-01-04 20:25 | - | |
| Immigration Game/ | 2020-12-09 13:56 | - | |
| Illicit/ | 2020-12-09 13:52 | - | |
| Icarus/ | 2022-01-04 20:25 | - | |
| I Dont Feel at Home ..> | 2022-01-04 20:25 | - | |
| I Am Chris Farley/ | 2020-12-09 13:50 | - | |
| I.Kill.Giants/ | 2020-12-09 13:51 | - | |
| Hunters Prayer/ | 2022-01-04 20:25 | - | |
| House on Elm Lake/ | 2020-12-09 13:50 | - | |
| Home Again/ | 2020-12-09 13:49 | - | |
| Highway to Havasu/ | 2020-12-09 13:49 | - | |
| High School Lover/ | 2020-12-19 03:29 | - | |
| High Heel Homicide/ | 2020-12-09 13:48 | - | |
| Hickok/ | 2020-12-09 13:48 | - | |
| Hickey/ | 2022-01-04 20:25 | - | |
| Heartland/ | 2020-12-09 13:48 | - | |
| Happy Hunting/ | 2022-01-04 20:25 | - | |
| Happy Death Day/ | 2020-12-09 13:48 | - | |
| Hap joek nam nui/ | 2020-12-09 13:47 | - | |
| Hanson.and.the.Beast/ | 2020-12-09 13:47 | - | |
| Handsome- A Netflix ..> | 2020-12-09 13:47 | - | |
| Halloween Pussy Trap..> | 2020-12-09 13:47 | - | |
| Guardians of the Gal..> | 2020-12-09 13:44 | - | |
| Grow House/ | 2020-12-09 13:43 | - | |
| Grey Lady/ | 2022-01-04 20:24 | - | |
| Granny of the Dead/ | 2020-12-09 13:43 | - | |
| Gong Shou Dao/ | 2020-12-09 13:42 | - | |
| Gold/ | 2022-01-04 20:24 | - | |
| Going in Style/ | 2020-12-09 13:42 | - | |
| God of War/ | 2020-12-09 13:42 | - | |
| Go North/ | 2020-12-09 13:31 | - | |
| Girls Trip/ | 2022-01-04 20:24 | - | |
| Girls Night Out/ | 2020-12-09 13:30 | - | |
| Girlfriend Killer/ | 2022-01-04 20:24 | - | |
| Girlfriend's Day/ | 2020-12-09 13:30 | - | |
| Girl Followed/ | 2021-02-18 00:06 | - | |
| Gifted/ | 2019-03-21 17:11 | - | |
| Ghosts of Darkness/ | 2020-12-09 13:30 | - | |
| Ghost in the Shell/ | 2020-12-09 13:30 | - | |
| Ghost Note/ | 2020-12-09 13:30 | - | |
| Ghost House/ | 2022-01-04 20:24 | - | |
| Getting Schooled/ | 2020-12-09 13:29 | - | |
| Get the Girl/ | 2020-12-09 20:28 | - | |
| Get Out/ | 2020-12-09 13:29 | - | |
| Geostorm/ | 2020-12-09 13:29 | - | |
| Geo-Disaster/ | 2022-01-04 20:23 | - | |
| Generation Iron 2/ | 2022-01-04 20:23 | - | |
| Galaxy of Horrors/ | 2020-12-09 13:24 | - | |
| Gaga Five Foot two/ | 2021-01-23 23:18 | - | |
| GadgetGang in Outer ..> | 2022-01-04 20:23 | - | |
| Fun Mom Dinner/ | 2022-01-04 20:23 | - | |
| From Straight As/ | 2020-12-09 13:24 | - | |
| Freehold/ | 2020-12-09 13:23 | - | |
| Frat Star/ | 2020-12-09 13:23 | - | |
| Framed for Murder/ | 2020-12-09 13:23 | - | |
| Forgotten Evil/ | 2020-12-09 13:23 | - | |
| Fist Fight/ | 2022-01-04 20:23 | - | |
| First Round Down/ | 2020-12-09 13:23 | - | |
| First Kill/ | 2020-12-09 13:23 | - | |
| Filth City/ | 2020-12-09 13:22 | - | |
| Fight Against Buddha/ | 2020-12-09 13:22 | - | |
| Fifty Shades Darker/ | 2020-12-09 20:27 | - | |
| Feed/ | 2022-01-04 20:23 | - | |
| Fallen Stars/ | 2021-08-05 16:02 | - | |
| Fabricated City/ | 2022-01-04 20:23 | - | |
| FANatic/ | 2022-01-04 20:23 | - | |
| Extraordinary Mission/ | 2020-12-09 13:21 | - | |
| Extortion/ | 2021-04-14 18:59 | - | |
| ExPatriot/ | 2020-12-09 13:21 | - | |
| Evil in Her/ | 2020-12-09 13:21 | - | |
| Everything, Everything/ | 2022-01-04 20:22 | - | |
| Everybody Loves Some..> | 2020-12-09 13:21 | - | |
| Es war einmal in Deu..> | 2020-12-09 13:17 | - | |
| Espionage Tonight/ | 2020-12-09 13:20 | - | |
| Escape Room/ | 2020-12-09 13:17 | - | |
| Empire of the Sharks/ | 2022-01-04 20:22 | - | |
| Eloise/ | 2022-01-04 20:22 | - | |
| Elite/ | 2021-01-04 00:40 | - | |
| Easy Living/ | 2020-12-09 13:16 | - | |
| Dunkrik/ | 2022-01-05 00:57 | - | |
| Duckweed/ | 2022-01-04 20:22 | - | |
| Drone/ | 2022-01-04 20:22 | - | |
| Dream the Impossible/ | 2021-03-27 16:25 | - | |
| Dream Journey II/ | 2020-12-09 13:15 | - | |
| Dragonheart- Battle ..> | 2022-01-04 20:22 | - | |
| Dragon Hunter/ | 2020-12-09 13:14 | - | |
| Doraemon- Great Adve..> | 2020-12-09 13:14 | - | |
| Dont Take Me Home/ | 2021-01-12 23:39 | - | |
| Disgraced/ | 2020-12-09 13:14 | - | |
| Diary of a Wimpy Kid..> | 2022-01-04 20:22 | - | |
| Diamond Cartel/ | 2022-01-04 20:22 | - | |
| Devils Gate/ | 2020-12-09 13:13 | - | |
| Devil in the Dark/ | 2020-12-09 13:13 | - | |
| Detroit/ | 2021-06-04 20:59 | - | |
| Despicable Me 3/ | 2020-12-09 13:13 | - | |
| Desire.2017/ | 2020-12-09 13:13 | - | |
| Descendants 2/ | 2020-12-09 13:12 | - | |
| Deidra & Laney Rob a..> | 2021-03-19 02:19 | - | |
| Death Race 2050/ | 2020-12-09 13:12 | - | |
| Death Note/ | 2020-12-09 13:11 | - | |
| Deadly Sorority/ | 2020-12-25 17:47 | - | |
| Deadly Lessons/ | 2021-04-10 23:44 | - | |
| Deadly Expose/ | 2020-12-09 13:10 | - | |
| Dead Story/ | 2022-01-04 20:21 | - | |
| Dead Over Heels- An ..> | 2022-01-04 20:21 | - | |
| Dead Again in Tombst..> | 2021-06-24 19:27 | - | |
| Day of Days/ | 2022-01-04 20:21 | - | |
| Darkness Rising/ | 2022-01-04 20:21 | - | |
| Darkland/ | 2021-04-05 22:10 | - | |
| Darker Shades of Elise/ | 2020-12-09 13:04 | - | |
| Dark Silence/ | 2019-03-21 17:01 | - | |
| Danger Close/ | 2020-12-09 13:04 | - | |
| Dance Academy/ | 2020-12-09 13:04 | - | |
| DC Vixen/ | 2020-12-09 13:07 | - | |
| DC Super Hero Girls-..> | 2020-12-09 13:07 | - | |
| Cute Little Buggers/ | 2020-12-09 13:03 | - | |
| Cut Shoot Kill/ | 2021-05-30 13:12 | - | |
| Cult of Chucky/ | 2020-12-09 13:03 | - | |
| Cross Wars/ | 2021-05-09 19:11 | - | |
| Crooked House/ | 2021-02-02 23:18 | - | |
| Creep 2/ | 2022-01-04 20:20 | - | |
| Cradle Swapping/ | 2022-01-04 20:20 | - | |
| CounterPunch/ | 2020-12-09 12:52 | - | |
| Cop and a Half- New ..> | 2020-12-09 12:52 | - | |
| Concrete Evidence- A..> | 2020-12-09 12:52 | - | |
| Columbus/ | 2022-01-04 20:20 | - | |
| Cold Zone/ | 2022-01-04 20:20 | - | |
| Coin Heist/ | 2022-01-04 20:40 | - | |
| Clowntergeist/ | 2021-06-07 23:24 | - | |
| Clinical/ | 2021-08-14 13:50 | - | |
| City Of Sin/ | 2020-12-09 12:37 | - | |
| Circus Kane/ | 2020-12-09 12:37 | - | |
| Cigarette Soup/ | 2020-12-09 12:37 | - | |
| Christmas Crime Story/ | 2021-01-26 20:42 | - | |
| Child Of Satan/ | 2020-12-09 12:33 | - | |
| Check Point[HD 720P]/ | 2020-12-09 12:33 | - | |
| Catching the Black W..> | 2020-12-09 12:33 | - | |
| Casting JonBenet/ | 2021-06-01 23:06 | - | |
| Captain Underpants/ | 2020-12-09 12:33 | - | |
| Camera Obscura/ | 2020-12-09 12:33 | - | |
| Call of the Wolf/ | 2020-12-09 12:33 | - | |
| Cabin 28/ | 2020-12-09 12:32 | - | |
| CHIPS/ | 2020-12-09 20:26 | - | |
| By Any Name/ | 2020-12-09 12:32 | - | |
| By Any Mean/ | 2020-12-09 12:32 | - | |
| Burning Sands/ | 2022-01-04 20:19 | - | |
| Bunyan and Babe/ | 2020-12-09 12:32 | - | |
| Bunnyman Vengeance/ | 2020-12-09 12:31 | - | |
| Britney Ever After/ | 2020-12-09 12:19 | - | |
| Bright/ | 2020-12-09 12:18 | - | |
| Breaking Point/ | 2020-12-09 12:18 | - | |
| Breaking Legs/ | 2020-12-09 12:18 | - | |
| Breaking Bad The Movie/ | 2020-12-09 12:17 | - | |
| Breakdown Lane/ | 2020-12-09 12:17 | - | |
| Brawl in Cell Block 99/ | 2022-01-04 20:19 | - | |
| Boyfriend Killer/ | 2020-12-09 12:16 | - | |
| Bottom of the World/ | 2020-12-09 12:16 | - | |
| Borstal/ | 2022-01-04 20:19 | - | |
| Borg vs McEnroe/ | 2022-01-04 20:19 | - | |
| Boone The Bounty Hun..> | 2020-12-09 12:16 | - | |
| Bonded by Blood 2/ | 2021-06-01 08:50 | - | |
| Bokeh/ | 2022-01-04 20:19 | - | |
| Bluebeard/ | 2020-12-09 12:15 | - | |
| Blowtorch/ | 2020-12-09 12:15 | - | |
| Bloodrunners/ | 2020-12-09 12:15 | - | |
| Blood Woods/ | 2020-12-09 12:14 | - | |
| Blood Money/ | 2020-12-09 12:14 | - | |
| Blood Hunt/ | 2020-12-09 12:13 | - | |
| Blood, Sand and Gold/ | 2020-12-09 12:15 | - | |
| Blame/ | 2022-01-04 20:18 | - | |
| Blade Runner 2049/ | 2022-01-04 20:18 | - | |
| Blade.of.the.Immortal/ | 2021-04-17 21:46 | - | |
| Black Snow/ | 2020-12-09 12:12 | - | |
| Black Site Delta/ | 2019-03-21 16:52 | - | |
| Black Butterfly/ | 2022-01-04 20:18 | - | |
| Birth of the Dragon/ | 2022-01-04 20:18 | - | |
| Bigger Fatter Liar/ | 2022-01-04 20:18 | - | |
| Bigfoot Horror/ | 2020-12-09 12:11 | - | |
| Big Bear/ | 2021-04-12 17:44 | - | |
| Beyond.Skyline/ | 2020-12-09 12:11 | - | |
| Bethany/ | 2022-01-04 20:39 | - | |
| Besetment/ | 2020-12-09 12:10 | - | |
| Berlin Syndrome/ | 2019-03-21 16:50 | - | |
| Behind The blue/ | 2020-12-09 12:10 | - | |
| Before I Fall/ | 2020-12-09 12:10 | - | |
| Becoming Bon/ | 2022-01-04 20:18 | - | |
| Beauty and the Beast/ | 2020-12-09 12:10 | - | |
| Beatriz at Dinner/ | 2020-12-09 12:10 | - | |
| Beaches/ | 2022-01-04 20:18 | - | |
| Batman & bill/ | 2021-04-08 04:11 | - | |
| Barbie Dolphin Magic/ | 2022-01-04 20:18 | - | |
| Bad Kids of Crestvie..> | 2021-04-30 02:04 | - | |
| Bad Frank/ | 2020-12-09 12:06 | - | |
| Bad Buzz/ | 2020-12-09 20:25 | - | |
| Baby Driver/ | 2020-12-09 12:06 | - | |
| Babs/ | 2020-12-09 12:06 | - | |
| BLEEDING STEEL/ | 2020-12-09 12:13 | - | |
| BERMUDA TENTACLES/ | 2020-12-09 12:10 | - | |
| B&B/ | 2020-12-09 12:06 | - | |
| Awakening the Zodiac/ | 2022-01-04 20:17 | - | |
| Awaken.the.Shadowman/ | 2020-12-09 12:03 | - | |
| Austin Found/ | 2020-12-09 12:03 | - | |
| Attraction/ | 2020-12-09 12:02 | - | |
| Atomica/ | 2020-12-09 12:02 | - | |
| Atomic.Blonde/ | 2020-12-09 12:01 | - | |
| Atlantis Rising/ | 2020-12-09 12:00 | - | |
| Asylum of Darkness/ | 2020-12-09 12:00 | - | |
| Asphalte/ | 2020-12-09 12:00 | - | |
| Arsenal/ | 2020-12-09 12:00 | - | |
| Armstrong/ | 2021-03-16 17:33 | - | |
| Arg Stairs/ | 2020-12-09 11:59 | - | |
| Apple of My Eye/ | 2020-12-09 11:56 | - | |
| Another You/ | 2022-01-04 20:17 | - | |
| Another Yeti a Love ..> | 2020-12-09 20:25 | - | |
| Annabelle Creation/ | 2020-12-09 11:56 | - | |
| Annabelle/ | 2020-12-09 11:55 | - | |
| An Uncommon Grace/ | 2022-01-04 20:17 | - | |
| Among Us/ | 2020-12-09 11:55 | - | |
| Amok/ | 2020-12-09 11:55 | - | |
| Amityville Exorcism/ | 2020-12-09 11:55 | - | |
| Amityville- The Awak..> | 2022-01-04 20:17 | - | |
| American Violence/ | 2020-12-09 11:55 | - | |
| American Made/ | 2020-12-09 11:54 | - | |
| American Exorcism/ | 2020-12-09 11:54 | - | |
| American Assassin/ | 2020-12-09 11:54 | - | |
| Amelia 2.0/ | 2020-12-09 11:54 | - | |
| Altitude/ | 2020-12-09 11:54 | - | |
| Alone/ | 2020-12-09 11:53 | - | |
| All Nighter/ | 2020-12-09 11:53 | - | |
| All Eyez on Me/ | 2021-01-04 16:58 | - | |
| All About the Money/ | 2020-12-09 11:53 | - | |
| Aliens vs Titanic/ | 2020-12-09 11:53 | - | |
| Alien Vs. Zombies/ | 2020-12-09 11:52 | - | |
| Alien Reign of Man/ | 2020-12-09 11:52 | - | |
| Alien Domicile/ | 2020-12-09 11:52 | - | |
| Alien Covenant/ | 2020-12-09 11:52 | - | |
| Aftermath/ | 2020-12-09 11:51 | - | |
| After School Special/ | 2020-12-09 11:51 | - | |
| Aenigma- Lucio Fulci..> | 2020-12-09 11:51 | - | |
| Acts Of Vengeance/ | 2021-01-06 11:56 | - | |
| A Woman Deceived/ | 2020-12-09 11:50 | - | |
| A Royal Winter/ | 2022-01-04 20:16 | - | |
| A Room to Die For/ | 2020-12-09 11:50 | - | |
| A Neighbors Deception/ | 2020-12-09 11:50 | - | |
| A Last Conjuring/ | 2020-12-09 11:50 | - | |
| A Grand Night In- Th..> | 2022-01-04 20:16 | - | |
| A Few Less Men/ | 2022-01-04 20:16 | - | |
| A Dog's Purpose/ | 2020-12-09 11:49 | - | |
| A Cowgirls Story/ | 2022-01-04 20:15 | - | |
| A Closer Walk with T..> | 2022-01-04 20:15 | - | |
| 1922/ | 2020-12-09 11:44 | - | |
| 626 Evolution/ | 2020-12-09 11:45 | - | |
| 68 Kill/ | 2022-01-04 20:15 | - | |
| 47 Meters Down/ | 2020-12-09 11:44 | - | |
| 24 Hours to live/ | 2020-12-09 11:44 | - | |
| 12 Pound Balls/ | 2020-12-09 11:43 | - | |
| 7 Witches/ | 2020-12-09 11:46 | - | |
| 6 Days/ | 2020-12-09 11:45 | - | |
| 6 Below Miracle on t..> | 2020-12-09 11:45 | - | |
| 3 Things/ | 2020-12-09 11:44 | - | |
| 2-22/ | 2020-12-09 11:44 | - | |
| 1 Mile to You/ | 2020-12-09 11:43 | - | |