![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[DIR]](/icons/bomb.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 4.20 Massacre/ | 2020-12-09 20:52 | - | |
| 5th Passenger/ | 2020-12-09 20:53 | - | |
| 6-Headed Shark Attack/ | 2022-01-04 20:41 | - | |
| 7 Days in Entebbe/ | 2020-12-09 20:53 | - | |
| 10×10/ | 2020-12-09 20:50 | - | |
| 12 Strong/ | 2020-12-09 20:50 | - | |
| 14 Cameras/ | 2022-01-16 12:45 | - | |
| 22 Chaser/ | 2020-12-09 20:51 | - | |
| 22 July/ | 2020-12-09 20:52 | - | |
| 51 Nevada/ | 2020-12-09 20:53 | - | |
| 211/ | 2022-01-16 12:45 | - | |
| A-X-L/ | 2020-12-09 20:57 | - | |
| A.Vigilante/ | 2022-01-04 20:41 | - | |
| A Better Tomorrow 4/ | 2020-12-09 20:54 | - | |
| A Boy A Girl A Dream/ | 2020-12-09 20:54 | - | |
| A Cool Fish/ | 2020-12-09 20:54 | - | |
| A Doll’s House/ | 2022-01-16 11:38 | - | |
| AI Is Coming/ | 2020-12-09 21:02 | - | |
| A Midnight Kiss/ | 2020-12-09 20:55 | - | |
| A Quiet Place/ | 2020-12-09 20:55 | - | |
| A Simple Favor/ | 2020-12-09 20:55 | - | |
| A Song for the Living/ | 2021-06-06 00:08 | - | |
| A Star Is Born/ | 2020-12-09 20:56 | - | |
| A Tale of Two Coreys/ | 2020-12-09 20:56 | - | |
| A Wrinkle in Time/ | 2020-12-09 20:56 | - | |
| Above Ground/ | 2020-12-09 20:57 | - | |
| Accident Man/ | 2020-12-09 20:57 | - | |
| Acrimony/ | 2020-12-09 20:59 | - | |
| Acts of Violence/ | 2020-12-09 20:59 | - | |
| Adrift/ | 2020-12-09 21:01 | - | |
| Adventure land/ | 2020-12-09 21:01 | - | |
| Agenda Payback/ | 2020-12-09 21:01 | - | |
| Agent Mr Chan/ | 2022-01-16 12:43 | - | |
| Air Strike/ | 2020-12-09 21:03 | - | |
| Alcatraz/ | 2021-05-27 19:03 | - | |
| Alien Code/ | 2020-12-09 21:04 | - | |
| Alien Expedition/ | 2020-12-09 21:04 | - | |
| Alien Overlords/ | 2020-12-09 21:04 | - | |
| Alien Predator/ | 2020-12-09 21:05 | - | |
| Alien Psychosis/ | 2020-12-09 21:05 | - | |
| Alien Siege/ | 2020-12-09 21:05 | - | |
| All Light Will End/ | 2020-12-09 21:06 | - | |
| Allure/ | 2020-12-09 21:06 | - | |
| Alone We Fight/ | 2020-12-09 21:06 | - | |
| Along with the Gods ..> | 2020-12-09 21:07 | - | |
| Alpha/ | 2020-12-09 21:08 | - | |
| Alpha Wolf/ | 2020-12-09 21:08 | - | |
| Altered Hours/ | 2020-12-09 21:08 | - | |
| Amazed By You/ | 2022-01-04 20:42 | - | |
| Amazon Hot Box/ | 2022-01-04 20:42 | - | |
| American Fright Fest/ | 2020-12-09 21:09 | - | |
| American Satan/ | 2020-12-09 21:10 | - | |
| An Accidental Zombie/ | 2020-12-09 21:10 | - | |
| Animal World/ | 2022-01-16 12:42 | - | |
| Annihilation/ | 2020-12-09 21:11 | - | |
| Anon/ | 2020-12-09 21:11 | - | |
| Anonymous 616/ | 2020-12-09 21:12 | - | |
| Anonymous Zombie/ | 2020-12-09 21:12 | - | |
| Another Soul/ | 2020-12-09 21:12 | - | |
| Another WolfCop/ | 2022-01-16 12:41 | - | |
| Ant-Man and the Wasp/ | 2020-12-09 21:12 | - | |
| Antidote/ | 2020-12-09 21:13 | - | |
| Antrum (2018) Engl..> | 2022-06-01 16:36 | - | |
| Any Bullet Will Do/ | 2020-12-09 21:13 | - | |
| Apostle/ | 2020-12-09 21:13 | - | |
| Apotheosis/ | 2020-12-09 21:14 | - | |
| Aquaman/ | 2020-12-09 21:14 | - | |
| Arizona/ | 2020-12-09 21:15 | - | |
| Armenian Haunting/ | 2020-12-09 21:15 | - | |
| Ashes in the Snow/ | 2020-12-09 21:15 | - | |
| Astral/ | 2020-12-09 21:15 | - | |
| Astro/ | 2020-12-09 21:15 | - | |
| Asylum of Fear/ | 2020-12-09 21:15 | - | |
| Atlantic Rim 2 Resur..> | 2022-01-04 20:43 | - | |
| Attraction/ | 2020-12-09 21:16 | - | |
| Aura/ | 2020-12-09 21:16 | - | |
| Avengers Grimm Time ..> | 2022-01-04 20:43 | - | |
| Avengers Infinity War/ | 2020-12-09 21:18 | - | |
| Await Further Instru..> | 2022-01-16 12:40 | - | |
| Backfire/ | 2021-05-24 09:51 | - | |
| Backstabbing for Beg..> | 2022-01-04 20:43 | - | |
| Backtrace/ | 2022-01-04 20:44 | - | |
| Bad Apples/ | 2020-12-09 21:20 | - | |
| Bad Cat The Movie/ | 2020-12-09 21:20 | - | |
| Bad Company/ | 2020-12-09 21:20 | - | |
| Bad Samaritan/ | 2021-02-12 12:59 | - | |
| Bad Times at the El ..> | 2020-12-09 21:21 | - | |
| Batman Gotham by Gas..> | 2020-12-09 21:21 | - | |
| Batman Ninja/ | 2020-12-09 21:21 | - | |
| Battalion/ | 2020-12-09 21:21 | - | |
| Battle Bots/ | 2020-12-09 21:22 | - | |
| Beast of Burden/ | 2020-12-09 21:22 | - | |
| Beatus/ | 2020-12-09 21:22 | - | |
| Bee Team/ | 2020-12-09 21:22 | - | |
| Before Someone Gets ..> | 2020-12-09 21:22 | - | |
| Behind the Walls/ | 2020-12-09 21:23 | - | |
| Beirut/ | 2022-01-16 12:39 | - | |
| Believer/ | 2020-12-09 21:23 | - | |
| Bent/ | 2020-12-09 21:23 | - | |
| Betrayed/ | 2020-12-09 21:24 | - | |
| Better Start Running/ | 2020-12-09 21:24 | - | |
| Between Worlds/ | 2020-12-09 21:25 | - | |
| Beyond The Clouds/ | 2020-12-09 21:25 | - | |
| Beyond White Space/ | 2022-01-04 20:44 | - | |
| Beyond the Edge/ | 2022-01-04 20:44 | - | |
| Big.Brother/ | 2020-12-09 21:27 | - | |
| Big.Legend/ | 2020-12-09 21:28 | - | |
| Bilal A New Breed of..> | 2020-12-09 21:28 | - | |
| Bird.Box/ | 2020-12-09 21:29 | - | |
| Birdland/ | 2020-12-09 21:29 | - | |
| Black.47/ | 2020-12-09 21:30 | - | |
| Black Panther/ | 2020-12-09 21:29 | - | |
| Black Poppy/ | 2020-12-09 21:29 | - | |
| Black Wake/ | 2022-01-04 20:45 | - | |
| Black Water/ | 2022-01-04 20:45 | - | |
| Blackmark/ | 2020-12-09 21:31 | - | |
| Blades/ | 2020-12-09 21:31 | - | |
| Bleach/ | 2021-01-24 21:05 | - | |
| Blockers/ | 2020-12-09 21:32 | - | |
| Blood Brother/ | 2022-01-04 20:45 | - | |
| Blood Clots/ | 2020-12-09 21:32 | - | |
| Blood Honey/ | 2020-12-09 21:33 | - | |
| Blood Prism/ | 2020-12-09 21:33 | - | |
| Blood Sweat and Terr..> | 2020-12-09 21:33 | - | |
| Blood and Glory/ | 2020-12-09 21:32 | - | |
| Bloody Nun/ | 2020-12-09 21:33 | - | |
| Boar/ | 2020-12-09 21:33 | - | |
| Boarding School/ | 2020-12-09 21:34 | - | |
| Body of Sin/ | 2020-12-09 21:34 | - | |
| Bodysnatch/ | 2020-12-09 21:35 | - | |
| Book of Monsters/ | 2022-01-16 12:38 | - | |
| Boost/ | 2020-12-09 21:35 | - | |
| Born Racer/ | 2020-12-09 21:35 | - | |
| Boyz 2/ | 2020-12-09 21:36 | - | |
| Braven/ | 2020-12-09 21:36 | - | |
| Breaking In/ | 2022-01-04 20:45 | - | |
| Broken/ | 2020-12-09 21:37 | - | |
| Broken Darkness/ | 2022-01-04 20:46 | - | |
| Brute Sanity/ | 2020-12-09 21:37 | - | |
| Bumblebee/ | 2020-12-09 21:37 | - | |
| Burning/ | 2021-02-08 21:27 | - | |
| BuyBust/ | 2020-12-09 21:38 | - | |
| California No/ | 2020-12-09 21:39 | - | |
| Cam/ | 2021-01-17 11:45 | - | |
| Carnivores/ | 2020-12-09 21:40 | - | |
| Cartel 2045/ | 2020-12-09 21:40 | - | |
| Champion/ | 2020-12-09 21:40 | - | |
| Cheerleader Chainsaw..> | 2020-12-09 21:41 | - | |
| Chen Xiang Half Past..> | 2020-12-09 21:41 | - | |
| Cherokee Creek/ | 2020-12-09 21:42 | - | |
| Children of the Corn..> | 2022-01-04 20:46 | - | |
| Chokehold/ | 2020-12-09 21:42 | - | |
| Christopher Robin/ | 2020-12-09 21:42 | - | |
| City Of Gold/ | 2020-12-09 21:43 | - | |
| Claras Ghost/ | 2020-12-09 21:44 | - | |
| Cocaine Godmother/ | 2020-12-09 21:44 | - | |
| Colette/ | 2021-04-17 00:56 | - | |
| Collider/ | 2020-12-09 21:45 | - | |
| Conjuring Curse/ | 2020-12-09 21:45 | - | |
| Conspiracy X/ | 2020-12-09 21:45 | - | |
| Constantine.City.of...> | 2020-12-09 21:46 | - | |
| Corbin Nash/ | 2022-01-04 20:46 | - | |
| Counterfeiting in Su..> | 2020-12-09 21:46 | - | |
| Countrycide/ | 2020-12-09 21:46 | - | |
| Crazy Rich Asians/ | 2020-12-09 21:46 | - | |
| Creed 2/ | 2020-12-09 21:47 | - | |
| Cucuy The Boogeyman/ | 2020-12-09 21:47 | - | |
| Curse of the Nun/ | 2020-12-09 21:47 | - | |
| Curse of the Witchs ..> | 2020-12-09 21:48 | - | |
| D-Railed/ | 2022-01-16 12:34 | - | |
| Dancing With Ghosts/ | 2021-06-27 00:56 | - | |
| Danger One/ | 2020-12-09 21:49 | - | |
| Dangerous House/ | 2020-12-09 21:49 | - | |
| Dangerous Matrimony/ | 2021-04-06 02:13 | - | |
| Darc/ | 2020-12-09 21:49 | - | |
| Dare Devil/ | 2020-12-09 21:50 | - | |
| Dark Beacon/ | 2020-12-09 21:50 | - | |
| Dark Was the Night/ | 2020-12-09 21:50 | - | |
| Darkness Wakes/ | 2022-01-04 20:47 | - | |
| Dashing Diljala/ | 2020-12-09 21:50 | - | |
| Dawn/ | 2020-12-09 21:51 | - | |
| Day of the Dead Bloo..> | 2022-01-04 20:47 | - | |
| Days Of Power/ | 2020-12-09 21:51 | - | |
| Dead List/ | 2020-12-09 21:52 | - | |
| Dead Men/ | 2020-12-09 19:18 | - | |
| Dead Squad Temple of..> | 2020-12-09 21:52 | - | |
| Dead Trigger/ | 2020-12-09 21:52 | - | |
| Dead in a Week Or Yo..> | 2020-12-09 21:51 | - | |
| Dead in the water/ | 2021-01-03 04:52 | - | |
| Deadly Relationship/ | 2020-12-09 21:52 | - | |
| Deadly Secrets by th..> | 2020-12-09 21:52 | - | |
| Deadpool 2/ | 2020-12-09 21:53 | - | |
| Deadsight/ | 2022-01-04 20:48 | - | |
| Deal With the Devil/ | 2020-12-09 21:53 | - | |
| Death Kiss/ | 2020-12-09 21:53 | - | |
| Death Race 4- Beyond..> | 2020-12-09 21:54 | - | |
| Death Wish/ | 2020-12-09 21:54 | - | |
| Deep Blue Sea 2/ | 2020-12-19 21:33 | - | |
| Defective/ | 2020-12-09 21:55 | - | |
| Delirium/ | 2020-12-09 21:55 | - | |
| Demon Catcher/ | 2020-12-09 21:56 | - | |
| Demon House/ | 2020-12-09 21:56 | - | |
| Demonia Undertaker/ | 2020-12-09 21:56 | - | |
| Demonte Colony/ | 2020-12-09 21:56 | - | |
| Den blomstertid nu k..> | 2020-12-09 21:57 | - | |
| Den of Thieves/ | 2020-12-09 21:57 | - | |
| Destination.Wedding/ | 2020-12-09 21:58 | - | |
| Detective Chinatown ..> | 2020-12-09 21:58 | - | |
| Detective Dee The Fo..> | 2020-12-09 21:59 | - | |
| Devil’s Tree Roote..> | 2020-12-09 21:59 | - | |
| Disobedience/ | 2020-12-09 21:59 | - | |
| Distorted/ | 2022-01-04 20:48 | - | |
| Domain/ | 2020-12-09 21:59 | - | |
| Don’t Leave Home/ | 2022-01-16 12:35 | - | |
| Don’t Open Your Eyes/ | 2020-12-09 22:00 | - | |
| Down River/ | 2022-01-16 12:35 | - | |
| Down a Dark Hall/ | 2022-01-16 12:35 | - | |
| Downrange/ | 2022-01-16 12:35 | - | |
| Dracula In Love/ | 2022-01-16 12:35 | - | |
| Dream Journey IV/ | 2022-01-16 12:33 | - | |
| Duck Butter/ | 2022-01-16 12:33 | - | |
| Duck Duck Goose/ | 2020-12-09 22:03 | - | |
| Early Man/ | 2020-12-09 22:03 | - | |
| Edge of Fear/ | 2020-12-09 22:04 | - | |
| Edge of Isolation/ | 2020-12-09 22:04 | - | |
| Elizabeth Harvest/ | 2020-12-09 22:04 | - | |
| Endless Loop/ | 2020-12-09 22:05 | - | |
| Enter The Wild/ | 2020-12-09 22:05 | - | |
| Epidemic/ | 2020-12-09 22:05 | - | |
| Escape Plan 2 Hades/ | 2020-12-09 22:06 | - | |
| Europe Raiders/ | 2020-12-09 22:06 | - | |
| Evil Aliens/ | 2021-05-27 11:55 | - | |
| Exorcism Master/ | 2021-07-07 23:14 | - | |
| Exposure/ | 2020-12-09 22:07 | - | |
| Extinction/ | 2020-12-09 22:08 | - | |
| Extremity/ | 2020-12-09 22:08 | - | |
| Eyes In The Hills/ | 2021-03-18 16:49 | - | |
| Fahrenheit.451/ | 2022-01-16 12:31 | - | |
| Family Blood/ | 2020-12-09 22:09 | - | |
| Fantastic Beasts The..> | 2022-01-16 11:52 | - | |
| Fantastic Beasts The..> | 2022-01-16 11:52 | - | |
| Far Cry 5 Inside Ede..> | 2020-12-09 22:09 | - | |
| Fatal Defense/ | 2020-12-09 22:09 | - | |
| Fear Level/ | 2020-12-09 22:09 | - | |
| Fearless/ | 2020-12-09 22:10 | - | |
| Feral/ | 2020-12-09 22:10 | - | |
| Fifty Shades Freed/ | 2020-12-09 22:11 | - | |
| Final Mission/ | 2020-12-09 22:11 | - | |
| Final Score/ | 2022-01-16 12:31 | - | |
| Finale 2018 Hindi OR..> | 2022-06-01 16:42 | - | |
| First Lady/ | 2020-12-09 22:12 | - | |
| First Man/ | 2022-01-16 12:30 | - | |
| First We Take Brooklyn/ | 2020-12-09 22:12 | - | |
| Flay/ | 2020-12-09 22:12 | - | |
| Flesh Wounds/ | 2020-12-09 22:12 | - | |
| Flight 666/ | 2020-12-09 22:12 | - | |
| Flora/ | 2020-12-09 22:13 | - | |
| Forbidden Power/ | 2020-12-09 22:13 | - | |
| Free Rein The Twelve..> | 2020-12-09 22:13 | - | |
| Frenzy/ | 2022-01-16 12:30 | - | |
| Future World/ | 2020-12-09 22:14 | - | |
| Future X-Cops/ | 2021-01-04 00:39 | - | |
| Galveston/ | 2020-12-09 22:15 | - | |
| Game Over Man/ | 2020-12-09 22:15 | - | |
| Garage Sale Mysterie..> | 2022-01-04 20:50 | - | |
| Garage Sale Mystery ..> | 2022-01-04 20:50 | - | |
| Gatao 2 Rise of the ..> | 2021-05-29 19:09 | - | |
| Genghis Khan To the ..> | 2022-01-16 12:29 | - | |
| Getaway/ | 2022-01-04 20:50 | - | |
| Ghost Stories/ | 2020-12-09 22:17 | - | |
| Ghostland/ | 2020-12-09 22:17 | - | |
| Gintama 2/ | 2020-12-09 22:17 | - | |
| Gintama 2 Rules Are ..> | 2020-12-09 22:17 | - | |
| Gloria.Bell/ | 2020-12-09 22:19 | - | |
| Godzilla City on the..> | 2021-03-02 10:31 | - | |
| Godzilla The Planet ..> | 2020-12-09 22:20 | - | |
| Golden Job/ | 2022-01-16 12:28 | - | |
| Gonjiam Haunted Asylum/ | 2020-12-09 22:21 | - | |
| Goodluck/ | 2020-12-09 22:21 | - | |
| Goosebumps 2 Haunted..> | 2020-12-09 22:21 | - | |
| Gotti/ | 2020-12-09 22:22 | - | |
| Grave Keeper/ | 2020-12-09 22:22 | - | |
| Greed Heavy Is The H..> | 2020-12-09 22:23 | - | |
| Guardians of the Tomb/ | 2020-12-09 22:23 | - | |
| Gwen/ | 2020-12-09 22:25 | - | |
| HDPOPCORNS Night-Zero/ | 2020-12-09 22:27 | - | |
| Hacker's Game Redux/ | 2020-12-09 22:25 | - | |
| Halloween/ | 2022-01-16 11:53 | - | |
| Halloween Horror Tales/ | 2020-12-09 22:25 | - | |
| Haunted 2- Apparitions/ | 2019-05-18 23:27 | - | |
| He's Out There/ | 2022-01-04 20:51 | - | |
| Headgame/ | 2020-12-09 22:27 | - | |
| Heaven & Hell/ | 2020-12-09 22:28 | - | |
| Heavens War/ | 2020-12-09 22:29 | - | |
| Hell’s Kitty/ | 2022-01-04 20:52 | - | |
| Hell Fest/ | 2020-12-09 22:29 | - | |
| Hell House LLC II Th..> | 2020-12-09 22:31 | - | |
| Hellraiser- Judgmen/ | 2020-12-09 22:31 | - | |
| Hens Night/ | 2020-12-09 22:31 | - | |
| Hereditary/ | 2022-01-16 12:27 | - | |
| Hide in the Light/ | 2022-01-04 20:52 | - | |
| Higher Power/ | 2020-12-09 22:33 | - | |
| Hold the Dark/ | 2020-12-09 22:33 | - | |
| Hollow Body/ | 2020-12-09 22:33 | - | |
| Hooligan Escape The ..> | 2020-12-09 22:34 | - | |
| Hornet/ | 2020-12-09 22:34 | - | |
| Hostage X/ | 2020-12-09 22:34 | - | |
| Hotel Artemis/ | 2022-01-16 11:54 | - | |
| Hotel Transylvania 3..> | 2020-12-09 22:34 | - | |
| House of Demons/ | 2020-12-09 22:34 | - | |
| Hover/ | 2020-12-09 22:35 | - | |
| How It Ends/ | 2020-12-09 22:35 | - | |
| How Long Will I Love U/ | 2020-12-09 22:36 | - | |
| Hunter Killer/ | 2022-01-16 11:54 | - | |
| Hunting Emma/ | 2020-12-09 22:36 | - | |
| Hurricane/ | 2020-12-09 22:36 | - | |
| I Am Toxic 2018 Hind..> | 2022-06-01 16:42 | - | |
| I Still See You/ | 2022-01-16 12:26 | - | |
| In Darkness/ | 2020-12-09 22:37 | - | |
| In Her Blood/ | 2020-12-09 22:37 | - | |
| In Memory Of/ | 2020-12-09 22:37 | - | |
| In This Gray Place/ | 2020-12-09 22:38 | - | |
| Incoming/ | 2020-12-09 22:38 | - | |
| Incontrol/ | 2020-12-09 22:39 | - | |
| Incredibles 2/ | 2020-12-09 22:39 | - | |
| Insidious The Last Key/ | 2022-01-04 20:53 | - | |
| Intensive Care/ | 2020-12-09 22:39 | - | |
| Intention/ | 2020-12-09 22:40 | - | |
| In the Cloud/ | 2020-12-09 22:37 | - | |
| Inuyashiki/ | 2020-12-09 22:40 | - | |
| Invincible/ | 2022-01-04 20:53 | - | |
| Invoking 5/ | 2020-12-09 22:41 | - | |
| Irreplaceable You/ | 2022-01-16 12:25 | - | |
| Island Zero/ | 2020-12-09 22:41 | - | |
| Isle of Dogs/ | 2022-01-04 20:53 | - | |
| It Lives Inside/ | 2020-12-09 22:41 | - | |
| Jackson Bolt/ | 2020-12-09 22:42 | - | |
| Jim Button And Luke ..> | 2020-12-09 22:42 | - | |
| Johhny English Reborn/ | 2021-06-07 23:19 | - | |
| Johnny English Strik..> | 2020-12-09 22:43 | - | |
| Jurassic Predator/ | 2020-12-09 22:43 | - | |
| Jurassic World Falle..> | 2020-12-09 22:43 | - | |
| Keep Watching/ | 2020-12-09 22:44 | - | |
| Killing Joan/ | 2020-12-09 22:45 | - | |
| Kin/ | 2020-12-09 22:46 | - | |
| Krampus Origins/ | 2020-12-09 22:46 | - | |
| Kung Fu Master/ | 2022-01-04 20:53 | - | |
| LADY NINJA/ | 2020-12-09 22:47 | - | |
| L Storm/ | 2020-12-09 22:46 | - | |
| Ladies First/ | 2021-08-01 12:09 | - | |
| Ladies in Black/ | 2021-05-07 02:00 | - | |
| Lake.Placid.Legacy/ | 2022-01-04 20:54 | - | |
| Lake Fear 3/ | 2020-12-09 22:47 | - | |
| Lasso/ | 2020-12-09 22:47 | - | |
| Last American Horror..> | 2020-12-09 22:48 | - | |
| Last Prince Of Atlan..> | 2020-12-09 22:48 | - | |
| Last Seen in Idaho/ | 2021-04-10 21:33 | - | |
| Lazer Team 2/ | 2022-01-16 12:24 | - | |
| Legendary Assassin/ | 2020-12-09 22:49 | - | |
| Lifechanger/ | 2020-12-09 22:49 | - | |
| Like Me/ | 2020-12-09 22:49 | - | |
| Lilith/ | 2020-12-09 22:50 | - | |
| Lionheart/ | 2020-12-09 22:51 | - | |
| Little Bitches/ | 2020-12-09 22:52 | - | |
| Living Among Us/ | 2020-12-09 22:52 | - | |
| Lizzie/ | 2020-12-09 22:54 | - | |
| Look Away/ | 2020-12-09 22:54 | - | |
| Lords of Chaos/ | 2022-01-16 12:23 | - | |
| Los Angeles Overnight/ | 2020-12-09 22:56 | - | |
| Lost Fare/ | 2020-12-09 22:56 | - | |
| Love On The Slopes/ | 2020-12-09 22:56 | - | |
| Loving Pablo/ | 2021-08-14 22:23 | - | |
| Lowlife/ | 2020-12-09 22:57 | - | |
| Lupt/ | 2020-12-09 22:57 | - | |
| Lust.Stories/ | 2020-12-09 22:58 | - | |
| M.I.A. A Greater Evil/ | 2020-12-09 22:58 | - | |
| MARS Inside SpaceX/ | 2020-12-09 23:01 | - | |
| Macbeth/ | 2020-12-09 22:58 | - | |
| Mad Genius/ | 2022-01-04 20:55 | - | |
| Mad World/ | 2022-01-16 12:22 | - | |
| Madeline's Madeline/ | 2022-01-04 20:55 | - | |
| Madtown/ | 2020-12-09 22:59 | - | |
| Making a Killing/ | 2020-12-09 22:59 | - | |
| Malevolence 3 Killer/ | 2020-12-09 22:59 | - | |
| Malicious/ | 2021-05-30 13:23 | - | |
| Mamma Mia Here We Go..> | 2022-01-04 20:55 | - | |
| Mandy/ | 2020-12-09 23:01 | - | |
| Mandy the Doll/ | 2020-12-09 23:01 | - | |
| Mary.Magdalene/ | 2022-01-16 12:21 | - | |
| Mary Poppins Returns/ | 2020-12-09 23:02 | - | |
| Mass V-s Class/ | 2020-12-09 23:04 | - | |
| May The Devil Take You/ | 2020-12-09 23:04 | - | |
| Maze Runner The Deat..> | 2020-12-09 23:05 | - | |
| Mercury/ | 2020-12-09 23:05 | - | |
| Mile 22/ | 2020-12-09 23:06 | - | |
| Minutes to Midnight/ | 2020-12-09 23:06 | - | |
| Mission Impossible F..> | 2020-12-09 23:06 | - | |
| Mission Xs/ | 2020-12-09 23:07 | - | |
| Mojin The Worm Valley/ | 2020-12-09 23:07 | - | |
| Mom and Dad/ | 2022-01-04 20:56 | - | |
| Monster Hunt 2/ | 2022-01-04 20:56 | - | |
| Monster Party/ | 2022-01-04 20:56 | - | |
| Mortal.Engines/ | 2020-12-09 23:09 | - | |
| Mortal Engines/ | 2020-12-09 23:08 | - | |
| Mowgli Legend of the..> | 2020-12-09 23:09 | - | |
| Mute/ | 2020-12-09 23:10 | - | |
| Nazi Overlord/ | 2020-12-09 23:10 | - | |
| New Chilling Tales t..> | 2020-12-09 23:11 | - | |
| Night Pulse/ | 2020-12-09 23:11 | - | |
| Night Zero/ | 2020-12-09 23:12 | - | |
| Nightshift/ | 2020-12-09 23:12 | - | |
| No Escape Room/ | 2020-12-09 23:12 | - | |
| Nowhere Mind/ | 2020-12-09 23:13 | - | |
| Occupation/ | 2020-12-09 23:13 | - | |
| Ocean’s 8/ | 2022-01-04 20:56 | - | |
| Ocean's Eight/ | 2020-12-09 23:14 | - | |
| Odds Are/ | 2020-12-09 23:15 | - | |
| Once Upon a Deadpool/ | 2020-12-09 23:16 | - | |
| On the Ropes/ | 2020-12-09 23:15 | - | |
| Operation.Finale/ | 2022-01-16 12:19 | - | |
| Operation Red Sea/ | 2020-12-09 23:16 | - | |
| Ouija House/ | 2022-01-04 20:57 | - | |
| Ouija Seance The Fin..> | 2020-12-09 23:17 | - | |
| Our House/ | 2020-12-09 23:17 | - | |
| Outlaw King/ | 2020-12-09 23:18 | - | |
| Outlawed/ | 2022-01-04 20:57 | - | |
| Out of the Shadows/ | 2021-02-03 11:51 | - | |
| Overlord/ | 2021-06-23 22:51 | - | |
| PLOEY - You Never Fl..> | 2021-04-21 19:00 | - | |
| Paddington 2/ | 2021-07-10 01:50 | - | |
| Panic Ghost Apartment/ | 2020-12-09 23:19 | - | |
| Paranormal Demons/ | 2020-12-09 23:19 | - | |
| Paranormal Evil/ | 2020-12-09 23:19 | - | |
| Party Bus to Hell/ | 2020-12-09 23:20 | - | |
| Patient Zero/ | 2020-12-09 23:20 | - | |
| Penance/ | 2020-12-09 23:20 | - | |
| Pepper mint/ | 2020-12-09 23:21 | - | |
| Peppermint/ | 2020-12-09 23:21 | - | |
| Perdida/ | 2020-12-09 23:22 | - | |
| Peter Pan The Quest ..> | 2020-12-09 23:22 | - | |
| Pharisee/ | 2020-12-09 23:22 | - | |
| Poseidon Rex/ | 2022-01-04 20:57 | - | |
| Possum/ | 2020-12-09 23:23 | - | |
| Predator World/ | 2020-12-09 23:24 | - | |
| Primal Rage/ | 2020-12-09 23:24 | - | |
| Project E.1337 ALPHA/ | 2021-04-10 23:54 | - | |
| Proud Mary/ | 2021-02-03 16:03 | - | |
| Psychokinesis/ | 2020-12-09 23:25 | - | |
| Pumpkins/ | 2020-12-09 23:27 | - | |
| Puppet Master_ The L..> | 2022-01-04 20:58 | - | |
| Puzzle/ | 2020-12-09 23:27 | - | |
| Ralph Breaks the Int..> | 2020-12-09 23:28 | - | |
| Rampage/ | 2020-12-09 23:28 | - | |
| Rampant/ | 2020-12-09 23:28 | - | |
| Ready Player One/ | 2020-12-09 23:28 | - | |
| Reborn/ | 2020-12-09 23:29 | - | |
| Recall/ | 2020-12-09 23:29 | - | |
| Red Sparrow/ | 2020-12-09 23:29 | - | |
| Redbad/ | 2022-01-16 12:17 | - | |
| Redcon-1/ | 2022-01-04 20:58 | - | |
| Relentless/ | 2020-12-09 23:30 | - | |
| Remote Viewing/ | 2020-12-09 23:30 | - | |
| Renegades/ | 2020-12-09 23:30 | - | |
| Replicas/ | 2020-12-09 23:31 | - | |
| Representation Of th..> | 2020-12-09 23:31 | - | |
| Reprisal/ | 2022-01-16 12:16 | - | |
| Restraint/ | 2020-12-09 23:32 | - | |
| Return of the Scarec..> | 2022-01-04 20:58 | - | |
| Revenger/ | 2020-12-09 23:32 | - | |
| Rideshare/ | 2020-12-09 23:32 | - | |
| Rise of the Footsold..> | 2020-12-09 23:32 | - | |
| River Runs Red/ | 2020-12-09 23:33 | - | |
| Robbery/ | 2020-12-09 23:33 | - | |
| Robin Hood/ | 2020-12-09 23:33 | - | |
| Robin Hood The Rebel..> | 2021-01-11 02:05 | - | |
| Ruin Me/ | 2021-06-16 01:02 | - | |
| Samson/ | 2022-01-16 12:16 | - | |
| Sara's Notebook/ | 2022-01-04 20:59 | - | |
| Save Wukong/ | 2020-12-09 23:35 | - | |
| Scooby-Doo & Batman ..> | 2021-04-14 18:58 | - | |
| Scorched Earth/ | 2022-01-04 20:59 | - | |
| Seal Team Six The Ra..> | 2020-12-09 23:35 | - | |
| Searching/ | 2020-12-09 23:35 | - | |
| Secret Santa/ | 2020-12-09 23:35 | - | |
| Secrets in the Hot S..> | 2021-05-06 21:48 | - | |
| Selfie from Hell/ | 2020-12-09 23:36 | - | |
| Separated at Birth/ | 2020-12-09 23:36 | - | |
| Sequence Break/ | 2020-12-09 23:36 | - | |
| Seven Years of Night/ | 2020-12-09 23:37 | - | |
| Seven in Heaven/ | 2020-12-09 23:36 | - | |
| Sgt. Stubby_ An Amer..> | 2020-12-09 23:37 | - | |
| Shanda’s River/ | 2020-12-09 23:37 | - | |
| Sherlock Gnomes/ | 2020-12-09 23:37 | - | |
| Shhhh/ | 2020-12-09 23:37 | - | |
| Shocking.Kungfu.Of.H..> | 2022-01-04 20:59 | - | |
| Shu Shan Xiang Mo Zh..> | 2020-12-09 23:38 | - | |
| Shuzan Demonic Harmo..> | 2020-12-09 23:38 | - | |
| Siberia/ | 2020-12-09 23:39 | - | |
| Sicario Day of the S..> | 2022-01-16 12:15 | - | |
| Sick for Toys/ | 2020-12-09 23:39 | - | |
| Siddarhta/ | 2020-12-09 23:39 | - | |
| Silencer/ | 2020-12-09 23:40 | - | |
| Silvat/ | 2020-12-09 23:40 | - | |
| Skateboard or Die/ | 2020-12-09 23:40 | - | |
| Skybound/ | 2022-01-04 21:00 | - | |
| Skyscraper/ | 2020-12-09 23:41 | - | |
| Slender Man/ | 2022-01-16 12:14 | - | |
| Smallfoot/ | 2020-12-09 23:42 | - | |
| Snake Outta Compton/ | 2020-12-09 23:42 | - | |
| Soft Matter/ | 2020-12-09 23:42 | - | |
| Solis/ | 2020-12-09 23:45 | - | |
| Solo A Star Wars Story/ | 2020-12-09 23:45 | - | |
| Space Guardians 2/ | 2020-12-09 23:45 | - | |
| Spider-Man Into the ..> | 2020-12-09 23:45 | - | |
| Spinning Man/ | 2020-12-09 23:46 | - | |
| Spiral/ | 2020-12-09 23:46 | - | |
| Squad Goals/ | 2020-12-09 23:47 | - | |
| Stephanie/ | 2022-01-04 21:00 | - | |
| Stillwater/ | 2020-12-09 23:47 | - | |
| Strange.Nature/ | 2022-01-16 12:14 | - | |
| Submergence/ | 2020-12-09 23:47 | - | |
| Suicide Squad Hell t..> | 2020-12-09 23:47 | - | |
| Summer of 84/ | 2022-01-16 12:13 | - | |
| SuperGrid/ | 2020-12-09 23:49 | - | |
| Super Troopers 2/ | 2022-01-16 12:13 | - | |
| Supercon/ | 2020-12-09 23:48 | - | |
| Sweet Country/ | 2020-12-09 23:49 | - | |
| Syndicate Smasher/ | 2020-12-09 23:49 | - | |
| TAU/ | 2020-12-09 23:50 | - | |
| THE GANG/ | 2020-12-10 00:03 | - | |
| Tales from the Hood 2/ | 2020-12-09 23:49 | - | |
| Tanki/ | 2020-12-09 23:50 | - | |
| Teen Titans Go! To t..> | 2020-12-09 23:50 | - | |
| Tell.Me.Your.Name/ | 2020-12-09 23:50 | - | |
| Temptation of Husban..> | 2020-12-09 23:51 | - | |
| Tempus Tormentum/ | 2020-12-09 23:51 | - | |
| Terminal/ | 2022-01-16 12:12 | - | |
| Terrortory 2/ | 2020-12-09 23:52 | - | |
| The.Dark.Kingdom/ | 2020-12-10 00:28 | - | |
| The.Domestics/ | 2022-01-04 21:06 | - | |
| The.First.Purge/ | 2020-12-10 00:29 | - | |
| The.Lotus/ | 2022-01-04 21:06 | - | |
| The.Ninth.Passenger/ | 2022-01-04 21:06 | - | |
| The 12th Man/ | 2020-12-09 23:52 | - | |
| The15.17 To Paris/ | 2020-12-10 00:31 | - | |
| The 15.17 to Paris/ | 2020-12-09 23:52 | - | |
| The Amityville Murders/ | 2020-12-09 23:53 | - | |
| The Appearance/ | 2020-12-09 23:53 | - | |
| The Ashram/ | 2020-12-09 23:53 | - | |
| The Bad Seed/ | 2020-12-09 23:53 | - | |
| The Barn/ | 2020-12-09 23:53 | - | |
| The Basement/ | 2020-12-09 23:54 | - | |
| The Beyond/ | 2021-02-06 02:41 | - | |
| The Blizzard/ | 2020-12-09 23:54 | - | |
| The Body Tree/ | 2022-01-16 12:11 | - | |
| The Bouncer/ | 2020-12-09 23:55 | - | |
| The Butchering/ | 2022-01-16 12:11 | - | |
| The Cabin/ | 2020-12-09 23:55 | - | |
| The Cage Fighter/ | 2020-12-09 23:56 | - | |
| The Campus/ | 2020-12-09 23:56 | - | |
| The Capture/ | 2022-01-04 21:02 | - | |
| The Catcher Was a Spy/ | 2020-12-09 23:56 | - | |
| The Clovehitch Killer/ | 2020-12-09 23:56 | - | |
| The Cloverfield Para..> | 2020-12-09 23:57 | - | |
| The Commuter/ | 2020-12-09 23:57 | - | |
| The Crossbreed/ | 2020-12-09 23:57 | - | |
| The Cured/ | 2020-12-09 23:57 | - | |
| The Dark Kingdom/ | 2020-12-09 23:57 | - | |
| The Darkest Minds/ | 2020-12-09 23:58 | - | |
| The Dawnseeker/ | 2022-01-04 21:02 | - | |
| The Death Of Stalin/ | 2022-01-04 21:02 | - | |
| The Debt Collector/ | 2022-01-04 21:02 | - | |
| The Dirty Relation/ | 2020-12-10 00:00 | - | |
| The Equalizer 2/ | 2020-12-10 00:00 | - | |
| The Escape of Prison..> | 2022-01-16 12:11 | - | |
| The Executioners/ | 2020-12-10 00:01 | - | |
| The Extraordinary Jo..> | 2020-12-10 00:02 | - | |
| The Farm/ | 2022-01-04 21:02 | - | |
| The Favourite/ | 2022-01-16 12:10 | - | |
| The Ferry Man Nether..> | 2020-12-10 00:02 | - | |
| The Final Blade (201..> | 2022-06-01 16:34 | - | |
| The First Date/ | 2020-12-10 00:02 | - | |
| The Forgiven/ | 2022-01-04 21:02 | - | |
| The Gateway/ | 2020-12-10 00:03 | - | |
| The Ghost Beyond/ | 2020-12-10 00:04 | - | |
| The Girl in the Spid..> | 2020-12-10 00:04 | - | |
| The Grinch/ | 2022-01-16 12:09 | - | |
| The Guilty/ | 2020-12-10 00:04 | - | |
| The Happytime Murders/ | 2020-12-10 00:05 | - | |
| The Hidden Soldier/ | 2020-12-10 00:05 | - | |
| The Hitman Agency/ | 2020-12-10 00:05 | - | |
| The Hollow Child/ | 2022-01-04 21:03 | - | |
| The House of Violent..> | 2020-12-10 00:06 | - | |
| The House with a Clo..> | 2020-12-10 00:06 | - | |
| The Hurricane Heist/ | 2020-12-10 00:07 | - | |
| The Hurt Locker/ | 2020-12-10 00:07 | - | |
| The Immortal Wars/ | 2020-12-10 00:07 | - | |
| The Incantation/ | 2020-12-10 00:08 | - | |
| The Incredible Monk/ | 2020-12-10 00:08 | - | |
| The Island/ | 2020-12-10 00:09 | - | |
| The Jade Pendant/ | 2022-01-16 12:02 | - | |
| The Joke Thief/ | 2020-12-10 00:09 | - | |
| The Jurassic Games/ | 2022-01-04 21:03 | - | |
| The King of the Drif..> | 2020-12-10 00:10 | - | |
| The Last Hangover/ | 2020-12-10 00:10 | - | |
| The Last Warrior (Th..> | 2020-12-10 00:11 | - | |
| The Last Witness/ | 2020-12-10 00:12 | - | |
| The Little Mermaid/ | 2020-12-10 00:12 | - | |
| The Little Witch/ | 2022-01-16 12:01 | - | |
| The Lodgers/ | 2020-12-10 00:12 | - | |
| The Lost Viking/ | 2020-12-10 00:12 | - | |
| The Lucky Man/ | 2022-01-04 21:04 | - | |
| The Lullaby/ | 2021-03-07 17:34 | - | |
| The Marine 6 Close Q..> | 2022-01-04 21:04 | - | |
| The Mason Brothers/ | 2020-12-10 00:14 | - | |
| The Meg/ | 2020-12-10 00:14 | - | |
| The Mermaid Lake of ..> | 2022-01-04 21:04 | - | |
| The Mirror of the So..> | 2020-12-10 00:15 | - | |
| The Miseducation of ..> | 2022-01-16 12:01 | - | |
| The Monkey King 3 Ki..> | 2020-12-10 00:16 | - | |
| The Negotiation/ | 2020-12-10 00:16 | - | |
| The Night Comes for Us/ | 2020-12-10 00:17 | - | |
| The Night Eats The W..> | 2022-01-04 21:04 | - | |
| The Nun/ | 2022-01-16 12:07 | - | |
| The Nursery/ | 2020-12-10 00:17 | - | |
| The Nutcracker and t..> | 2022-01-16 12:09 | - | |
| The Old Man and the ..> | 2020-12-10 00:18 | - | |
| The Open House/ | 2022-01-04 21:04 | - | |
| The Outer Wild/ | 2020-12-10 00:18 | - | |
| The Outsider/ | 2020-12-10 00:19 | - | |
| The Perfect Day/ | 2021-02-03 11:53 | - | |
| The Pinch/ | 2020-12-10 00:19 | - | |
| The Polka King/ | 2022-01-04 21:04 | - | |
| The Possession of Ha..> | 2020-12-10 00:20 | - | |
| The Predator/ | 2020-12-10 00:20 | - | |
| The Princess and the..> | 2022-01-04 21:05 | - | |
| The Quake/ | 2020-12-10 00:21 | - | |
| The Quake A.K.A.Skje..> | 2022-01-16 12:06 | - | |
| The Rake/ | 2020-12-10 00:21 | - | |
| The Revenge of Rober..> | 2020-12-10 00:22 | - | |
| The Rocket/ | 2020-12-10 00:22 | - | |
| The Scorpion King Bo..> | 2021-01-24 18:02 | - | |
| The Sisters Brothers/ | 2021-06-14 23:22 | - | |
| The Spider and The Web/ | 2021-01-03 04:53 | - | |
| The Spy Who Dumped Me/ | 2020-12-10 00:23 | - | |
| The Stolen Princess/ | 2020-12-10 00:24 | - | |
| The Story Of Pure Ball/ | 2020-12-10 00:24 | - | |
| The Strangers Prey a..> | 2020-12-10 00:24 | - | |
| The Super/ | 2022-01-04 21:05 | - | |
| The System/ | 2020-12-10 00:24 | - | |
| The Tag Along Devil ..> | 2020-12-10 00:25 | - | |
| The Take Down/ | 2020-12-10 00:25 | - | |
| The Tale/ | 2022-01-04 21:05 | - | |
| The Terrible Two/ | 2022-01-04 21:05 | - | |
| The Thinning_ New Wo..> | 2020-12-10 00:26 | - | |
| The Titan/ | 2020-12-10 00:27 | - | |
| The Toybox/ | 2020-12-10 00:27 | - | |
| The Unity Of Heroes/ | 2020-12-10 00:27 | - | |
| The Vanishing/ | 2022-01-16 11:59 | - | |
| The War Records Of D..> | 2020-12-10 00:27 | - | |
| The Wasting/ | 2020-12-10 00:27 | - | |
| The Watcher/ | 2021-06-05 22:20 | - | |
| The Witch Files/ | 2020-12-10 00:28 | - | |
| The Witch in the Win..> | 2022-01-04 21:06 | - | |
| The keeper/ | 2020-12-10 00:10 | - | |
| They Remain/ | 2020-12-10 00:31 | - | |
| They Shall Not Grow ..> | 2020-12-10 00:32 | - | |
| Thousand Yard Stare/ | 2020-12-10 00:32 | - | |
| Till The End of The ..> | 2020-12-10 00:32 | - | |
| Time Freak/ | 2020-12-10 00:33 | - | |
| Time Will Tell/ | 2020-12-10 00:33 | - | |
| To All the Boys I've..> | 2020-12-10 00:33 | - | |
| Tomb.Invader/ | 2022-01-04 21:06 | - | |
| Tomb Raider/ | 2020-12-10 00:34 | - | |
| Touch And See What H..> | 2020-12-10 00:35 | - | |
| Traffik/ | 2020-12-10 00:36 | - | |
| Tremors A Cold Day i..> | 2020-12-10 00:36 | - | |
| Trench 11/ | 2022-01-04 21:06 | - | |
| Triassic World/ | 2022-01-04 21:06 | - | |
| Troy The Resurrectio..> | 2020-12-10 00:37 | - | |
| True Love Story/ | 2020-12-10 00:37 | - | |
| Truth or Dare/ | 2020-12-10 00:38 | - | |
| Tsunami/ | 2020-12-10 00:38 | - | |
| Under the Silver Lake/ | 2020-12-10 00:39 | - | |
| Unfriended Dark Web/ | 2020-12-10 00:39 | - | |
| Union/ | 2021-01-19 14:08 | - | |
| Unsane/ | 2020-12-10 00:40 | - | |
| Upgrade/ | 2020-12-10 00:40 | - | |
| Vengeance/ | 2020-12-10 00:41 | - | |
| Venom/ | 2020-12-10 00:43 | - | |
| Viking.Destiny/ | 2022-01-16 11:57 | - | |
| Vir Das Losing It/ | 2020-12-10 00:44 | - | |
| Virus of the Dead/ | 2020-12-10 00:44 | - | |
| Voldemort Origins of..> | 2020-12-10 00:44 | - | |
| War Raiders/ | 2020-12-10 00:44 | - | |
| Wastelander/ | 2021-01-22 00:59 | - | |
| Watch If You Dare/ | 2020-12-10 00:45 | - | |
| Welcome Home/ | 2020-12-10 00:45 | - | |
| West of Hell/ | 2020-12-10 00:45 | - | |
| What.Keeps.You.Alive/ | 2021-08-15 16:55 | - | |
| What Keeps You Alive/ | 2022-01-16 11:57 | - | |
| What Still Remains/ | 2021-04-01 09:49 | - | |
| Wheely/ | 2022-01-04 21:07 | - | |
| When We First Met/ | 2020-12-10 22:49 | - | |
| When the Angels Sleep/ | 2020-12-10 00:47 | - | |
| White Boy Rick/ | 2021-08-14 22:16 | - | |
| White Fang/ | 2020-12-10 00:49 | - | |
| White Orchid/ | 2020-12-10 00:49 | - | |
| Why Hide/ | 2020-12-10 00:49 | - | |
| Wicked witches/ | 2020-12-10 00:50 | - | |
| Wild 7/ | 2022-01-04 21:07 | - | |
| Wildling/ | 2020-12-10 00:50 | - | |
| Winchester/ | 2020-12-10 00:50 | - | |
| Winter Ridge/ | 2020-12-10 00:51 | - | |
| Wretches/ | 2020-12-10 00:51 | - | |
| Wunderland/ | 2020-12-10 00:51 | - | |
| You Might Be the Kil..> | 2022-01-04 21:08 | - | |
| Your Move/ | 2020-12-10 00:51 | - | |
| Zombie World 2/ | 2020-12-10 00:52 | - | |
| hellmington/ | 2020-12-09 22:31 | - | |
| iGirlfriend/ | 2020-12-09 22:36 | - | |
| kamarunnahar/ | 2022-01-05 01:04 | - | |
| karmouz war/ | 2020-12-09 22:44 | - | |
| looking glass/ | 2022-01-04 20:54 | - | |
| nekrotronic/ | 2022-01-04 20:56 | - | |
| nomis/ | 2022-01-04 20:56 | - | |
| rosie/ | 2022-01-16 12:16 | - | |
| the last sharknado i..> | 2022-01-04 21:03 | - | |