![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1st Summoning/ | 2022-02-20 17:31 | - | |
| 3 From Hell/ | 2022-02-20 17:31 | - | |
| 6 Underground/ | 2022-02-20 17:31 | - | |
| 10.1979/ | 2022-02-20 17:32 | - | |
| 10 Minutes Gone/ | 2022-02-20 17:32 | - | |
| 12 Suicidal Teens/ | 2022-02-20 17:32 | - | |
| 15 Rounds/ | 2022-02-20 17:33 | - | |
| 21 Bridges/ | 2022-02-20 17:33 | - | |
| 47 Meters Down Uncaged/ | 2022-02-20 17:33 | - | |
| 72 Hours Martyr Who ..> | 2022-02-20 17:33 | - | |
| 90 Minutes/ | 2022-02-20 17:33 | - | |
| 100 Yards/ | 2022-02-20 17:33 | - | |
| 706/ | 2022-02-20 17:33 | - | |
| 1162 Fighting For Th..> | 2022-02-20 17:34 | - | |
| 1917/ | 2022-02-20 17:34 | - | |
| 2050/ | 2022-02-20 17:34 | - | |
| 3022/ | 2022-02-20 17:34 | - | |
| A.M.I/ | 2022-02-20 17:35 | - | |
| A Dog's Way Home/ | 2022-02-20 17:34 | - | |
| A Lady Next Door/ | 2022-02-20 17:34 | - | |
| A Madea Family Funeral/ | 2022-02-20 17:35 | - | |
| A Monks Madness 2/ | 2022-02-20 17:35 | - | |
| A Monsoon Date/ | 2022-02-20 17:35 | - | |
| A Rainy Day in New Y..> | 2022-02-20 17:35 | - | |
| A Score to Settle/ | 2022-02-20 17:35 | - | |
| A Vigilante/ | 2022-02-20 17:35 | - | |
| A Violent Separation/ | 2022-02-20 17:35 | - | |
| A Young Man With Hig..> | 2022-02-20 17:35 | - | |
| Abduction/ | 2022-02-20 17:35 | - | |
| Abigail/ | 2022-02-20 17:36 | - | |
| Above the Best/ | 2022-02-20 17:36 | - | |
| Acceleration/ | 2022-02-20 17:36 | - | |
| Acceptable Damage/ | 2022-02-20 17:37 | - | |
| Ad Astra/ | 2022-02-20 17:37 | - | |
| Adopt a Highway/ | 2022-02-20 17:37 | - | |
| Adventures of Aladdin/ | 2022-02-20 17:37 | - | |
| After/ | 2022-02-20 17:37 | - | |
| After Darkness/ | 2022-02-20 17:37 | - | |
| Against the Clock/ | 2022-02-20 17:38 | - | |
| Agent of Deceit/ | 2022-02-20 17:38 | - | |
| Airplane Mode/ | 2022-02-20 17:38 | - | |
| Aladdin/ | 2022-02-20 17:38 | - | |
| Albert Pinto Ko Guss..> | 2022-02-20 17:38 | - | |
| Alexa & Katie/ | 2022-02-20 17:39 | - | |
| Alien Warfare/ | 2022-02-20 17:39 | - | |
| Alita Battle Angel/ | 2022-02-20 17:39 | - | |
| All Must Die/ | 2022-02-20 17:39 | - | |
| All You Ever Wished ..> | 2022-02-20 17:39 | - | |
| All is True/ | 2022-02-20 17:39 | - | |
| Alread gone/ | 2022-02-20 17:39 | - | |
| Altered Skin/ | 2022-02-20 17:39 | - | |
| American Hangman/ | 2022-02-20 17:39 | - | |
| American Terror Story/ | 2022-02-20 17:40 | - | |
| An Affair to Die For/ | 2022-02-20 17:40 | - | |
| Ana/ | 2022-02-20 17:40 | - | |
| Angel Has Fallen/ | 2022-02-20 17:40 | - | |
| Anna/ | 2022-02-20 17:40 | - | |
| Anna 2/ | 2022-02-20 17:40 | - | |
| Annabelle Comes Home/ | 2022-02-20 17:40 | - | |
| Arctic/ | 2022-02-20 17:40 | - | |
| As You Like It/ | 2022-02-20 17:41 | - | |
| Ashes in the Snow/ | 2022-02-20 17:41 | - | |
| Ask For Jane/ | 2022-02-20 17:41 | - | |
| Assassinaut/ | 2022-02-20 17:41 | - | |
| Assimilate/ | 2022-02-20 17:41 | - | |
| Astro Kid/ | 2022-02-20 17:46 | - | |
| At Two Thirty/ | 2022-02-20 17:46 | - | |
| Aurora/ | 2022-02-20 17:46 | - | |
| Avalanche/ | 2022-02-20 17:47 | - | |
| Avengers Endgame/ | 2022-02-20 17:47 | - | |
| Awake/ | 2022-02-20 17:47 | - | |
| BRATSTVO/ | 2022-02-20 17:56 | - | |
| Back To Zero/ | 2022-02-20 17:47 | - | |
| Back of the Net/ | 2022-02-20 17:47 | - | |
| Bad Dose/ | 2022-02-20 17:47 | - | |
| Badland/ | 2022-02-20 17:48 | - | |
| Balance Not Symmetry/ | 2022-02-20 17:48 | - | |
| Balkanskiy rubezh a...> | 2022-02-20 17:48 | - | |
| Balloon/ | 2022-02-20 17:48 | - | |
| Bao Qing Tian Xue Ch..> | 2022-02-20 17:49 | - | |
| Batman vs. Teenage M..> | 2022-02-20 17:53 | - | |
| Battalion 609/ | 2022-02-20 17:53 | - | |
| Be Happy/ | 2022-02-20 17:53 | - | |
| Being Frank/ | 2022-02-20 17:53 | - | |
| Beneath Us/ | 2022-02-20 17:54 | - | |
| Bennett's War/ | 2022-02-20 17:54 | - | |
| Big Top Evil/ | 2022-02-20 17:54 | - | |
| Bigger/ | 2022-02-20 17:54 | - | |
| Bittersweet Symphony/ | 2022-02-20 17:54 | - | |
| Blackbear/ | 2022-02-20 17:54 | - | |
| Blade Lady Of Ming/ | 2022-02-20 17:55 | - | |
| Bliss/ | 2022-02-20 17:55 | - | |
| Blood Bound/ | 2022-02-20 17:55 | - | |
| Blood Craft/ | 2022-02-20 17:55 | - | |
| Bodies At Rest/ | 2022-02-20 17:55 | - | |
| Bombshell/ | 2022-02-20 17:56 | - | |
| Book of Monsters/ | 2022-02-20 17:56 | - | |
| Boudica Rise Of The ..> | 2022-02-20 17:56 | - | |
| Breakthrough/ | 2022-02-20 17:56 | - | |
| Brexit The Uncivil War/ | 2022-02-20 17:58 | - | |
| Brightburn/ | 2022-02-20 17:59 | - | |
| Buffalo Boys/ | 2022-02-20 17:59 | - | |
| Bundy and the Green ..> | 2022-02-20 17:59 | - | |
| Burn/ | 2022-02-20 17:59 | - | |
| Camp Wedding/ | 2022-02-20 17:59 | - | |
| Can You Keep A Secret/ | 2022-02-20 17:59 | - | |
| Candy Corn/ | 2022-02-20 17:59 | - | |
| Captain Black/ | 2022-02-20 17:59 | - | |
| Captain Marvel/ | 2020-12-10 02:19 | - | |
| Captive State/ | 2020-12-10 02:20 | - | |
| Cats/ | 2022-01-04 21:14 | - | |
| Chain Of Death/ | 2020-12-10 02:21 | - | |
| Charlie's Angels/ | 2020-12-10 02:21 | - | |
| Childs Play/ | 2020-12-10 02:22 | - | |
| Chimera Strain/ | 2020-12-10 02:22 | - | |
| Chopstick/ | 2020-12-10 02:23 | - | |
| City of Lies/ | 2022-01-04 21:14 | - | |
| Cleavers Killer Clowns/ | 2020-12-10 02:24 | - | |
| Clickbait/ | 2020-12-10 02:26 | - | |
| Close/ | 2020-12-10 02:26 | - | |
| Clownado/ | 2020-12-10 02:27 | - | |
| Code 8/ | 2021-01-26 00:16 | - | |
| Cold Blood/ | 2020-12-10 02:28 | - | |
| Cold Blood Legacy/ | 2020-12-10 02:28 | - | |
| Cold Pursuit/ | 2020-12-10 02:29 | - | |
| Colourblind/ | 2020-12-10 02:29 | - | |
| Come.As.You.Are/ | 2021-01-13 06:07 | - | |
| Concrete Kids/ | 2020-12-10 02:31 | - | |
| Countdown/ | 2022-01-04 21:36 | - | |
| Cowboy and Indiana/ | 2020-12-10 02:31 | - | |
| Crawl/ | 2021-07-04 20:17 | - | |
| Creature.From.Cannib..> | 2020-12-10 02:32 | - | |
| Creed 2/ | 2020-12-10 02:33 | - | |
| Crucible Of The Vamp..> | 2020-12-10 02:33 | - | |
| Cry Havoc/ | 2021-05-27 20:04 | - | |
| Crystals shadow/ | 2020-12-10 02:34 | - | |
| Cuck/ | 2020-12-10 02:34 | - | |
| Cutterhead/ | 2022-01-04 21:14 | - | |
| Cyan Wizard/ | 2020-12-10 02:35 | - | |
| D-Day/ | 2021-01-04 00:45 | - | |
| D-Day Dog Company/ | 2020-12-10 02:36 | - | |
| D-O Parvathamma/ | 2019-07-08 16:54 | - | |
| Daming Records/ | 2020-12-10 02:36 | - | |
| Danger Close/ | 2021-01-23 20:16 | - | |
| Daniel Isn't Real/ | 2022-01-04 21:15 | - | |
| Dark Phoenix/ | 2020-12-10 02:36 | - | |
| Darkness Visible/ | 2020-12-10 02:37 | - | |
| Darlin/ | 2021-05-08 20:29 | - | |
| Daughter Of The Wolf/ | 2020-12-10 02:39 | - | |
| Deadly Switch/ | 2020-12-10 02:40 | - | |
| Deadwood The Movie/ | 2020-12-10 02:40 | - | |
| Deception Of The Nov..> | 2020-12-10 02:41 | - | |
| Defiant/ | 2020-12-10 02:41 | - | |
| Descendants/ | 2020-12-10 02:42 | - | |
| Descendants 3/ | 2020-12-10 02:43 | - | |
| Destination Dewsbury/ | 2020-12-10 02:43 | - | |
| Destroyer/ | 2020-12-10 02:44 | - | |
| Devil Vs Vindate/ | 2020-12-10 02:44 | - | |
| Devils Revenge/ | 2020-12-10 02:44 | - | |
| Diablo. The Race For..> | 2022-01-04 21:15 | - | |
| Disappearance/ | 2019-12-11 23:47 | - | |
| Doctor Sleep/ | 2021-06-11 14:09 | - | |
| Dogman/ | 2020-12-10 02:47 | - | |
| Dolemite Is My Name/ | 2022-01-04 21:15 | - | |
| Dolittle/ | 2020-12-10 02:48 | - | |
| Dolls/ | 2022-01-04 21:16 | - | |
| Dolphin Kick/ | 2020-12-10 02:48 | - | |
| Domino/ | 2020-12-10 02:48 | - | |
| Donnybrook/ | 2022-01-04 21:16 | - | |
| Donovan.Reid/ | 2020-12-10 02:49 | - | |
| Doom Annihilation/ | 2020-12-10 02:50 | - | |
| Doom Room/ | 2020-12-10 02:51 | - | |
| Door In The Woods/ | 2020-12-10 02:51 | - | |
| Dora and the Lost Ci..> | 2020-12-10 08:27 | - | |
| Double Echo/ | 2020-12-10 02:51 | - | |
| Downton Abbey/ | 2022-01-04 21:36 | - | |
| Dragon Awakening/ | 2020-12-10 02:52 | - | |
| Draug/ | 2020-12-10 02:52 | - | |
| DreadOut Tower of Hell/ | 2020-12-10 02:53 | - | |
| Dreamfactory/ | 2020-12-10 02:55 | - | |
| Drive/ | 2020-12-10 02:56 | - | |
| Driven/ | 2020-12-10 02:57 | - | |
| Dumbo/ | 2022-01-04 21:36 | - | |
| East Dragon/ | 2020-12-10 02:58 | - | |
| El Camino - A Breaki..> | 2020-12-10 02:59 | - | |
| El Camino A Breaking..> | 2020-12-10 03:00 | - | |
| Eli/ | 2020-08-10 22:28 | - | |
| Encounter/ | 2020-12-10 03:00 | - | |
| Enemy within/ | 2021-03-18 16:48 | - | |
| Escape.Plan.The.Extr..> | 2020-12-10 03:02 | - | |
| Escape Room/ | 2020-12-10 03:02 | - | |
| Escape and Evasion/ | 2020-12-10 03:01 | - | |
| Eternal Code/ | 2022-01-04 21:16 | - | |
| Evil Empire Friday t..> | 2020-12-10 03:03 | - | |
| Extra Ordinary/ | 2022-01-04 21:17 | - | |
| Extracurricular/ | 2020-08-07 01:52 | - | |
| Extreme Job A.K.A Ge..> | 2020-12-10 03:04 | - | |
| Extremely Wicked Sho..> | 2020-12-10 03:04 | - | |
| Fall in Love at Firs..> | 2020-12-10 03:05 | - | |
| Fast And Furious Pre..> | 2020-12-10 03:05 | - | |
| Father and Hero/ | 2020-12-10 03:06 | - | |
| Feedback/ | 2021-01-22 11:15 | - | |
| Fierce Fighting On M..> | 2020-12-10 03:06 | - | |
| Fighting/ | 2020-12-10 03:06 | - | |
| Fighting with My Fam..> | 2020-12-10 03:07 | - | |
| Filter Coffee Liquor..> | 2021-04-14 18:59 | - | |
| FireBrand/ | 2020-12-10 03:08 | - | |
| Fish School 2/ | 2021-02-03 11:51 | - | |
| Five Feet Apart/ | 2020-12-10 03:09 | - | |
| FollowMe/ | 2022-02-20 17:31 | - | |
| Ford v Ferrari/ | 2020-12-10 03:10 | - | |
| Foreign Exchange/ | 2020-12-10 03:10 | - | |
| Fractured/ | 2020-12-10 03:10 | - | |
| Friend Zone/ | 2020-12-10 03:10 | - | |
| From the dead/ | 2022-01-04 21:17 | - | |
| Frozen 2/ | 2020-12-10 03:11 | - | |
| Frozen II/ | 2020-12-10 03:12 | - | |
| Game Over/ | 2020-12-10 03:12 | - | |
| Gates of Paradise/ | 2020-12-10 03:12 | - | |
| Gemini Man/ | 2020-12-11 00:51 | - | |
| General Commander/ | 2020-12-10 03:13 | - | |
| Ghost/ | 2020-12-10 03:13 | - | |
| Ghost Storm/ | 2020-12-10 03:13 | - | |
| Ghulam The Revolt (R..> | 2020-12-10 03:14 | - | |
| Giant Little Ones/ | 2021-06-27 00:41 | - | |
| Girl in Red/ | 2020-12-10 03:14 | - | |
| Girl on the Third Fl..> | 2022-01-04 21:18 | - | |
| Girls.Guns.and.Blood/ | 2020-08-11 21:12 | - | |
| Glass/ | 2020-12-10 03:16 | - | |
| Godzilla King of the..> | 2020-12-10 03:17 | - | |
| Good Boys/ | 2020-12-10 03:18 | - | |
| Good Sam/ | 2020-12-10 03:18 | - | |
| Gorilla/ | 2020-12-10 03:18 | - | |
| Gosnell The Trial of..> | 2020-12-10 03:19 | - | |
| Grand Isle/ | 2020-12-10 03:19 | - | |
| Greyhound Attack/ | 2020-12-10 03:20 | - | |
| Guava Island/ | 2020-12-10 03:20 | - | |
| Gun Shot/ | 2020-12-10 03:21 | - | |
| Gunshot/ | 2020-12-10 03:22 | - | |
| Gutterbug/ | 2020-12-10 03:22 | - | |
| HERO/ | 2020-12-10 03:27 | - | |
| HITMAN AGENT JUN/ | 2020-12-10 03:41 | - | |
| Hala/ | 2020-12-10 03:23 | - | |
| Happy Death Day 2U/ | 2020-12-10 03:23 | - | |
| Happy to catch the t..> | 2020-12-10 03:23 | - | |
| Hard Night Falling/ | 2022-01-04 21:18 | - | |
| Harpoon/ | 2020-12-10 08:46 | - | |
| Haunt/ | 2020-12-10 03:24 | - | |
| Headlock/ | 2020-12-10 03:24 | - | |
| Heaven/ | 2021-05-27 11:55 | - | |
| Heavenly Sword Biogr..> | 2020-12-10 03:24 | - | |
| Hellboy/ | 2020-12-10 08:41 | - | |
| Here Awhile/ | 2020-12-10 03:26 | - | |
| High Note/ | 2020-12-10 03:27 | - | |
| High On The Hog/ | 2020-12-10 03:40 | - | |
| High Resolution/ | 2020-12-10 03:41 | - | |
| Hit and run squad/ | 2020-12-10 03:41 | - | |
| Hoax/ | 2021-01-03 16:40 | - | |
| Holiday Date/ | 2020-12-10 03:42 | - | |
| Holiday Hell/ | 2021-04-10 23:39 | - | |
| Holiday Rush/ | 2020-12-10 03:43 | - | |
| Horrible Histories T..> | 2020-12-10 03:44 | - | |
| Horror Night/ | 2022-01-04 21:19 | - | |
| How to Build a Girl ..> | 2022-06-01 16:55 | - | |
| How to Train Your Dr..> | 2020-12-10 03:45 | - | |
| Hunt Down/ | 2020-11-04 15:48 | - | |
| Huo Yuan Jia Fearless/ | 2019-11-07 19:59 | - | |
| Huo Yuanjia/ | 2022-01-04 21:37 | - | |
| Hustlers/ | 2021-07-15 21:06 | - | |
| I Am Mother/ | 2022-01-04 21:19 | - | |
| IO/ | 2022-01-04 21:37 | - | |
| IP Man And Four Kings/ | 2020-12-10 03:56 | - | |
| I See You/ | 2021-01-17 23:11 | - | |
| IT Chapter Two/ | 2021-06-23 22:46 | - | |
| Idol/ | 2020-12-10 03:46 | - | |
| Illuminated/ | 2020-12-10 03:46 | - | |
| Illuminated The True..> | 2020-12-10 03:47 | - | |
| Im Just Fucking With..> | 2020-12-10 03:47 | - | |
| In Bed with A Killerr/ | 2021-04-10 23:40 | - | |
| In Like Flynn/ | 2022-01-04 21:37 | - | |
| Infernum/ | 2020-12-10 03:49 | - | |
| Inhuman Kiss/ | 2020-12-10 03:50 | - | |
| Inside Bills Brain D..> | 2020-12-10 03:50 | - | |
| Inside Man Most Wanted/ | 2022-01-04 21:20 | - | |
| In the Port of Cape ..> | 2020-12-10 03:48 | - | |
| In the Shadow of the..> | 2020-12-10 03:49 | - | |
| In the Tall Grass/ | 2020-12-10 03:49 | - | |
| Into the Ashes/ | 2020-12-10 03:51 | - | |
| Into the Forest/ | 2020-12-10 03:54 | - | |
| Invasion Planet Earth/ | 2020-12-10 03:54 | - | |
| Ip Man 4/ | 2020-12-10 03:55 | - | |
| Ip Man 4 The Finale/ | 2021-05-14 00:54 | - | |
| Isn't It Romantic/ | 2020-12-10 03:56 | - | |
| Itsy Bitsy/ | 2022-01-04 21:37 | - | |
| Jarhead Law Of Return/ | 2021-05-26 15:28 | - | |
| Jexi/ | 2022-01-04 21:37 | - | |
| Jim Knopf und Lukas ..> | 2020-12-10 03:57 | - | |
| John Wick Chapter 3 ..> | 2020-12-10 03:57 | - | |
| Jojo Rabbit/ | 2020-12-10 03:58 | - | |
| Joker/ | 2020-12-10 03:59 | - | |
| Journey to China The..> | 2022-01-04 21:37 | - | |
| Journey to the East/ | 2020-12-10 03:59 | - | |
| Judgemental Hai Kya/ | 2020-12-10 03:59 | - | |
| Jumanji The Next Level/ | 2021-02-09 20:46 | - | |
| Justice League vs th..> | 2020-12-10 04:00 | - | |
| Kanne Kalaimaane/ | 2020-12-10 04:00 | - | |
| Kevin Hart Irrespons..> | 2022-01-04 21:37 | - | |
| Kidnapping Stella/ | 2020-12-10 04:01 | - | |
| Kill Chain/ | 2021-04-05 22:06 | - | |
| Kill Mode/ | 2020-12-10 04:02 | - | |
| Killed My Wife/ | 2020-12-10 04:02 | - | |
| Killer Cove/ | 2019-09-30 19:19 | - | |
| Killer Sofa/ | 2021-05-24 09:53 | - | |
| Killerman/ | 2021-07-18 02:21 | - | |
| Kim possible/ | 2020-12-10 04:03 | - | |
| Kingdom/ | 2020-12-10 04:04 | - | |
| King of Crime/ | 2020-12-10 04:04 | - | |
| King of Thieves/ | 2019-03-21 21:22 | - | |
| Kiss Kiss/ | 2022-01-04 21:38 | - | |
| Klaus/ | 2020-12-10 04:04 | - | |
| Knight of Shadows Wa..> | 2020-12-10 04:05 | - | |
| Knives Out/ | 2021-02-15 00:24 | - | |
| Krasue Inhuman Kiss/ | 2020-12-10 04:05 | - | |
| Kursk/ | 2022-01-04 21:21 | - | |
| Lady and the Tramp/ | 2020-12-10 04:05 | - | |
| Last Christmas/ | 2020-12-10 04:06 | - | |
| Late Night/ | 2020-12-10 04:06 | - | |
| Lazarat/ | 2021-01-22 00:40 | - | |
| Legend of the Deom S..> | 2020-12-10 04:07 | - | |
| Legiony/ | 2020-12-10 04:09 | - | |
| Let It Snow/ | 2022-01-04 21:22 | - | |
| Liao Zhai Qun Pu/ | 2020-12-10 04:10 | - | |
| Line Walker 2 Invisi..> | 2020-12-10 04:10 | - | |
| Line of Duty/ | 2022-01-04 21:22 | - | |
| Little Monsters/ | 2020-12-10 04:11 | - | |
| Little Play Bones/ | 2020-12-10 04:11 | - | |
| Living Space/ | 2020-12-10 04:11 | - | |
| Living with Yourself/ | 2020-12-10 04:12 | - | |
| Locating Silver Lake/ | 2020-12-10 04:12 | - | |
| Lock Dragon Valley/ | 2020-12-10 04:12 | - | |
| Long Live The King/ | 2020-01-15 04:55 | - | |
| Long Shot/ | 2021-06-27 00:47 | - | |
| Loophole/ | 2020-12-10 04:13 | - | |
| Lost In Space/ | 2020-12-10 04:14 | - | |
| Love Struck Sick/ | 2020-12-10 04:14 | - | |
| Low Low/ | 2020-12-10 04:14 | - | |
| Lucky Day/ | 2021-07-06 00:08 | - | |
| Lucy in the Sky/ | 2020-12-10 04:16 | - | |
| MFKZ/ | 2022-01-04 21:23 | - | |
| Ma/ | 2021-06-22 16:52 | - | |
| Made In China/ | 2020-12-10 04:17 | - | |
| Made In Malta/ | 2020-12-10 04:17 | - | |
| Maleficent Mistress ..> | 2020-12-18 19:00 | - | |
| Malibu Rescue/ | 2020-12-10 04:18 | - | |
| Manifest Destiny Dow..> | 2021-04-21 19:00 | - | |
| Matt and Mou 2019/ | 2020-12-10 04:19 | - | |
| Mayday/ | 2020-12-10 04:20 | - | |
| Men in Black Interna..> | 2020-12-10 04:21 | - | |
| Mercy Black/ | 2021-05-21 14:16 | - | |
| Mermaid Down/ | 2022-01-04 21:38 | - | |
| Metamorphosis/ | 2020-12-10 04:22 | - | |
| Mia and the White Lion/ | 2022-01-04 21:23 | - | |
| Midnight Ruins/ | 2020-12-10 04:24 | - | |
| Midsommar/ | 2020-12-10 04:25 | - | |
| Midway/ | 2021-01-22 22:10 | - | |
| Miss Bala/ | 2020-12-10 04:25 | - | |
| Mob Town/ | 2022-01-04 21:38 | - | |
| Mojin The Worm Valley/ | 2020-12-10 04:40 | - | |
| Mollywood/ | 2020-12-10 04:41 | - | |
| Mommy Would Never Hu..> | 2021-02-03 11:51 | - | |
| Monkey King The Volc..> | 2020-12-10 04:41 | - | |
| Monsters and Men/ | 2021-06-16 17:16 | - | |
| Moonlit Winter/ | 2020-12-10 04:42 | - | |
| Mortal Ouija/ | 2020-12-10 04:42 | - | |
| Motherless Brooklyn/ | 2020-12-10 04:43 | - | |
| Mummy Island Bethal ..> | 2020-12-10 04:44 | - | |
| Mummy Reborn/ | 2021-04-10 23:52 | - | |
| Murder Mystery/ | 2020-12-10 04:44 | - | |
| Mute Date/ | 2019-12-05 16:07 | - | |
| My Daughters Ransom/ | 2022-01-04 21:24 | - | |
| My Soul To Keep/ | 2020-12-10 04:45 | - | |
| My Wife's Secret Life/ | 2021-05-09 19:13 | - | |
| Native Son/ | 2020-12-10 04:45 | - | |
| Nereus/ | 2021-02-03 11:51 | - | |
| Never Grow Old/ | 2022-02-21 14:45 | - | |
| Next Gen/ | 2020-12-10 04:46 | - | |
| Night Hunter/ | 2022-02-21 14:44 | - | |
| No Man's Land/ | 2020-12-10 04:48 | - | |
| No Mercy/ | 2022-02-21 14:44 | - | |
| No Place Like Home/ | 2020-12-10 04:48 | - | |
| Norm of the North Ke..> | 2020-12-10 04:49 | - | |
| Norm of the North Ki..> | 2020-12-10 04:49 | - | |
| Not Alone/ | 2020-12-10 04:50 | - | |
| Notebook/ | 2022-02-21 14:43 | - | |
| O G/ | 2020-12-10 04:51 | - | |
| Once Upon A Time In ..> | 2020-12-10 04:51 | - | |
| Once Upon a Time In ..> | 2022-02-21 14:43 | - | |
| One Car Four Servants/ | 2020-12-10 04:52 | - | |
| One Winter Night/ | 2020-02-08 22:48 | - | |
| Only Mine/ | 2020-12-10 04:52 | - | |
| Ouijageist/ | 2020-12-10 04:53 | - | |
| Outlaws.Dont.Get.Fun..> | 2020-12-10 04:53 | - | |
| Overlord/ | 2020-12-10 04:53 | - | |
| PARASITE/ | 2022-02-21 14:42 | - | |
| P Storm/ | 2020-12-10 04:54 | - | |
| Pain and Glory/ | 2022-02-21 14:42 | - | |
| Paradise Hills/ | 2022-02-21 14:41 | - | |
| Patient Zero/ | 2020-12-10 04:58 | - | |
| Pegasus/ | 2020-12-10 04:58 | - | |
| Pegasus Pony with a ..> | 2020-12-10 04:58 | - | |
| Pentagram/ | 2020-12-10 04:59 | - | |
| Perfect/ | 2020-12-10 04:59 | - | |
| Perjanjian Dengan Ib..> | 2020-12-10 04:59 | - | |
| Pet Graveyard/ | 2020-12-21 17:18 | - | |
| Pet Sematary/ | 2020-12-10 05:00 | - | |
| Photograph/ | 2020-12-10 05:00 | - | |
| Piercing/ | 2020-12-10 05:01 | - | |
| Play Or Die/ | 2020-12-10 05:03 | - | |
| Playmobil The Movie/ | 2022-02-21 14:41 | - | |
| Pokemon Detective Pi..> | 2020-12-10 05:04 | - | |
| Polar/ | 2020-12-10 05:04 | - | |
| Polaroid/ | 2022-02-21 14:40 | - | |
| Pond Life/ | 2020-12-10 05:05 | - | |
| Portal/ | 2020-12-10 05:06 | - | |
| Poslednee ispytanie/ | 2020-12-10 05:06 | - | |
| Premature/ | 2020-12-10 05:07 | - | |
| Prey/ | 2020-12-11 12:55 | - | |
| Programs/ | 2020-12-10 05:08 | - | |
| Project Ithaca/ | 2021-03-24 01:51 | - | |
| Prospect/ | 2020-12-10 05:08 | - | |
| Pulled to Hell/ | 2020-12-10 05:09 | - | |
| Queen of Hearts/ | 2020-12-10 05:10 | - | |
| Quiet Storm The Ron ..> | 2020-12-10 05:11 | - | |
| ROAD KILL/ | 2020-12-10 05:25 | - | |
| Rabid/ | 2020-12-10 05:12 | - | |
| Racetime/ | 2022-01-04 21:26 | - | |
| Radioflash/ | 2020-12-10 05:13 | - | |
| Rambo last blood/ | 2020-12-10 05:13 | - | |
| Rampaat/ | 2020-12-10 05:13 | - | |
| Rattlesnake/ | 2022-02-21 14:39 | - | |
| Ready or Not/ | 2020-12-10 05:14 | - | |
| Ready to Mingle/ | 2020-12-10 05:15 | - | |
| Reality Queen/ | 2020-12-10 05:15 | - | |
| Recall/ | 2022-02-21 14:39 | - | |
| Recovery/ | 2022-02-21 14:39 | - | |
| Red Devil/ | 2020-12-10 05:17 | - | |
| Red Island/ | 2020-12-10 05:17 | - | |
| Red Room/ | 2020-12-10 05:17 | - | |
| Regionrat/ | 2020-12-10 05:19 | - | |
| Reign of the Supermen/ | 2020-12-10 05:19 | - | |
| Return to Horror Hotel/ | 2021-04-09 12:20 | - | |
| Revenger/ | 2022-02-21 14:37 | - | |
| Ride/ | 2020-12-10 05:23 | - | |
| Ride Like a Girl/ | 2022-02-21 14:37 | - | |
| Riot Girls/ | 2020-12-10 05:24 | - | |
| Ripleys Believe It o..> | 2020-12-10 05:24 | - | |
| Rise of the Footsold..> | 2020-12-10 05:25 | - | |
| Robert Reborn/ | 2020-12-24 22:46 | - | |
| Robert The Bruce/ | 2022-02-21 14:38 | - | |
| Robocall/ | 2020-12-10 05:26 | - | |
| Rocketman/ | 2022-02-21 14:37 | - | |
| Rogue Warfare/ | 2022-02-21 14:36 | - | |
| Rome in Love/ | 2020-12-10 05:27 | - | |
| Romulus & Remus The ..> | 2022-02-21 14:35 | - | |
| Room for Rent/ | 2020-12-10 05:28 | - | |
| Root Cause/ | 2020-12-10 05:29 | - | |
| Rootwood/ | 2020-12-10 05:29 | - | |
| Running with the Devil/ | 2020-12-10 05:30 | - | |
| Run the Race/ | 2022-02-21 14:35 | - | |
| SGT Will Gardner/ | 2021-01-27 01:07 | - | |
| Sacren/ | 2020-12-10 05:31 | - | |
| Saja a.k.a. The Divi..> | 2022-02-21 14:35 | - | |
| Scarecrows Revenge/ | 2020-12-10 05:32 | - | |
| Scary Stories to Tel..> | 2022-02-21 14:34 | - | |
| School Spirits/ | 2020-12-10 05:32 | - | |
| Secret Obsession/ | 2022-02-21 14:33 | - | |
| Section 375/ | 2020-12-10 05:33 | - | |
| Seduced by a Killer ..> | 2022-01-04 21:27 | - | |
| Seeds/ | 2020-12-10 05:34 | - | |
| Semper/ | 2022-02-21 14:33 | - | |
| Semper Fi/ | 2022-01-04 21:39 | - | |
| Serenity/ | 2022-02-21 14:33 | - | |
| Sextuplets/ | 2020-12-10 05:36 | - | |
| Shadow Wolves/ | 2020-12-10 05:36 | - | |
| Shanghai Fortress/ | 2022-02-21 14:32 | - | |
| Share/ | 2020-12-12 13:22 | - | |
| Shazam!/ | 2022-02-21 14:32 | - | |
| She's Just A Shadow/ | 2020-12-10 05:40 | - | |
| Showing Room/ | 2020-12-10 05:40 | - | |
| Sinister Seduction/ | 2020-12-10 05:41 | - | |
| Skyfire/ | 2022-02-21 14:18 | - | |
| Slaughterhouse Rulez/ | 2020-12-10 05:42 | - | |
| Sleeping Dogs Lie/ | 2020-12-10 05:43 | - | |
| Snow Monster/ | 2021-01-20 06:23 | - | |
| Soni/ | 2020-12-10 05:44 | - | |
| Soul Hunters/ | 2022-01-04 21:39 | - | |
| Soul to Keep/ | 2022-02-21 14:18 | - | |
| Spider-Man Far from ..> | 2022-02-21 14:17 | - | |
| Spider in the Web/ | 2022-02-21 14:18 | - | |
| Spiral Farm/ | 2020-12-10 05:46 | - | |
| Spiritual Twins Unde..> | 2021-05-27 11:54 | - | |
| St. Agatha/ | 2020-12-10 05:46 | - | |
| St.Judy/ | 2020-12-10 05:47 | - | |
| Star Wars The Rise o..> | 2020-12-10 05:47 | - | |
| Stargate Origins Cat..> | 2020-12-10 05:48 | - | |
| State Like Sleep/ | 2022-02-20 19:53 | - | |
| Stay.Out.Stay.Alive/ | 2019-12-05 17:18 | - | |
| Stay Out Stay Alive/ | 2020-12-10 05:49 | - | |
| Step Up China/ | 2022-02-20 19:52 | - | |
| Step Up High Water/ | 2020-12-10 05:50 | - | |
| Still/ | 2020-12-10 05:50 | - | |
| Storm Boy/ | 2019-10-11 23:29 | - | |
| Strange Events 2/ | 2020-12-10 05:52 | - | |
| Strawberry Flavored ..> | 2020-12-10 05:52 | - | |
| Street Flow/ | 2020-12-10 05:53 | - | |
| Stuber/ | 2020-12-11 04:13 | - | |
| Sturgill Simpson Pre..> | 2020-12-10 05:53 | - | |
| Surprise/ | 2020-12-10 05:54 | - | |
| Svaha The Sixth Finger/ | 2022-02-20 19:49 | - | |
| Sweetheart/ | 2020-12-11 07:40 | - | |
| Swell/ | 2020-12-10 05:54 | - | |
| THE.ROOKIES/ | 2022-01-04 21:34 | - | |
| THE ROOKIES/ | 2022-02-20 19:48 | - | |
| Take Home Pay/ | 2020-12-10 05:55 | - | |
| Take Point/ | 2020-12-10 05:55 | - | |
| Tall Girl/ | 2020-12-10 05:56 | - | |
| Tazza One Eyed Jack/ | 2020-12-10 05:56 | - | |
| Teen Spirit/ | 2020-12-10 05:57 | - | |
| Terminator Dark Fate/ | 2020-12-10 05:58 | - | |
| The.Car.Road.to.Reve..> | 2020-12-10 07:32 | - | |
| The.Courier/ | 2019-12-05 17:18 | - | |
| The.Driver/ | 2019-12-05 17:18 | - | |
| The.Evil.Inside.Her/ | 2022-02-20 18:21 | - | |
| The.House.of.Murderers/ | 2020-12-10 07:34 | - | |
| The.Jack.in.the.Box/ | 2022-01-04 21:34 | - | |
| The.Tangle/ | 2022-01-04 21:34 | - | |
| The.Tracker/ | 2021-01-03 04:50 | - | |
| The.True.Don.Quixote/ | 2019-12-23 18:38 | - | |
| The 9th Precinct/ | 2022-02-20 19:34 | - | |
| The 27 Club/ | 2020-12-10 05:58 | - | |
| The Accidental Prime..> | 2020-12-10 05:59 | - | |
| The Addams Family/ | 2022-02-20 19:33 | - | |
| The Aeronauts/ | 2022-02-20 19:33 | - | |
| The Angry Birds 2/ | 2020-12-10 05:59 | - | |
| The Art of Self-Defe..> | 2020-12-10 06:00 | - | |
| The Assent/ | 2022-02-20 19:31 | - | |
| The Axiom/ | 2020-12-10 06:01 | - | |
| The Bad Guys Reign o..> | 2019-11-26 13:55 | - | |
| The Balkan Line/ | 2020-12-10 06:02 | - | |
| The Baylock Residence/ | 2022-01-04 21:39 | - | |
| The Beast/ | 2020-12-10 06:02 | - | |
| The Big Trip/ | 2020-12-10 06:03 | - | |
| The Birdcatcher/ | 2020-12-10 06:03 | - | |
| The Body/ | 2020-12-10 06:04 | - | |
| The Car Road to Reve..> | 2020-12-10 06:05 | - | |
| The Chain/ | 2020-12-10 06:05 | - | |
| The Cleaning Lady/ | 2020-12-10 06:06 | - | |
| The Cleansing Hour/ | 2022-02-20 19:30 | - | |
| The Climbers/ | 2022-02-20 19:30 | - | |
| The Courier/ | 2020-12-31 00:10 | - | |
| The Current War/ | 2022-01-04 21:30 | - | |
| The Curse Of Buckout..> | 2020-12-10 06:08 | - | |
| The Curse of La Llor..> | 2020-12-10 13:07 | - | |
| The Dark Kingdom/ | 2020-12-10 06:08 | - | |
| The Dark Kingdom S&S/ | 2020-12-10 06:10 | - | |
| The Dark Side of Lif..> | 2020-12-10 06:10 | - | |
| The Dead Dont Die/ | 2020-12-10 06:10 | - | |
| The Death and Return..> | 2022-02-20 19:29 | - | |
| The Demonologist/ | 2020-12-10 06:13 | - | |
| The Directive/ | 2020-12-10 06:14 | - | |
| The Dragon Unleashed/ | 2020-12-10 06:14 | - | |
| The Driver/ | 2021-01-09 22:47 | - | |
| The Earthquake Bird/ | 2020-12-10 06:15 | - | |
| The Edge of Democracy/ | 2022-02-20 19:11 | - | |
| The Fanatic/ | 2022-02-20 19:11 | - | |
| The Favourite/ | 2022-02-20 19:10 | - | |
| The Field/ | 2019-12-30 18:24 | - | |
| The Filthy Thirteen/ | 2020-12-10 06:17 | - | |
| The Final Wish/ | 2020-12-10 06:17 | - | |
| The Flood/ | 2020-12-10 06:18 | - | |
| The Furies/ | 2022-02-20 19:10 | - | |
| The Gallows Act II/ | 2022-02-20 19:09 | - | |
| The Gangster The Cop..> | 2020-12-10 06:20 | - | |
| The Ghetto Superman/ | 2020-12-10 06:20 | - | |
| The Ghost Who Walks/ | 2020-12-10 06:20 | - | |
| The Girl in the Spid..> | 2020-12-10 06:21 | - | |
| The Golden Glove/ | 2022-02-20 19:09 | - | |
| The Goldfinch/ | 2022-02-20 19:09 | - | |
| The Golem/ | 2022-02-20 19:08 | - | |
| The Great Sage Sun W..> | 2020-12-10 06:24 | - | |
| The Great War/ | 2022-01-04 21:31 | - | |
| The Hard Way/ | 2022-02-20 19:08 | - | |
| The Haunting Of Borl..> | 2021-08-05 15:00 | - | |
| The Haunting of Shar..> | 2022-02-20 19:07 | - | |
| The Head Hunter/ | 2020-12-10 06:27 | - | |
| The Hole in the Ground/ | 2022-02-20 19:07 | - | |
| The Hummingbird Proj..> | 2020-12-10 06:29 | - | |
| The Hustle/ | 2020-12-10 06:30 | - | |
| The I-Land/ | 2020-12-10 06:31 | - | |
| The Informer/ | 2022-02-20 19:06 | - | |
| The Intruder/ | 2022-02-20 19:05 | - | |
| The Irishman/ | 2022-01-04 21:39 | - | |
| The Isle/ | 2022-02-20 19:05 | - | |
| The Jack in the Box/ | 2022-02-20 19:04 | - | |
| The Kid Who Would Be..> | 2022-02-20 18:33 | - | |
| The Kill Team/ | 2022-02-20 18:32 | - | |
| The King/ | 2020-12-10 06:33 | - | |
| The King of Fighters/ | 2022-02-20 18:32 | - | |
| The Knight Before Ch..> | 2020-12-10 06:35 | - | |
| The Knight of Shadow..> | 2020-12-10 06:35 | - | |
| The Last Boy/ | 2020-12-10 06:36 | - | |
| The Laundromat/ | 2020-12-10 06:37 | - | |
| The Layover/ | 2020-12-10 06:38 | - | |
| The Legend of Secret..> | 2020-12-10 06:38 | - | |
| The Lighthouse/ | 2020-12-10 06:39 | - | |
| The Lion King/ | 2020-12-10 06:39 | - | |
| The Little Switzerland/ | 2020-12-10 06:40 | - | |
| The Lovely Mrs. Mook..> | 2020-12-10 06:40 | - | |
| The Madness Within/ | 2020-12-10 06:41 | - | |
| The Man Standing Next/ | 2020-12-10 06:41 | - | |
| The Man Who Killed D..> | 2022-02-20 18:31 | - | |
| The Manson Family Ma..> | 2021-06-03 23:16 | - | |
| The Martyr Maker/ | 2021-08-02 12:24 | - | |
| The Mercenary/ | 2020-12-10 06:44 | - | |
| The Messenger/ | 2020-12-10 06:46 | - | |
| The Monster Girl/ | 2021-01-03 04:05 | - | |
| The Mortuary Collect..> | 2022-02-20 18:30 | - | |
| The Mummy Rebirth/ | 2020-12-10 06:48 | - | |
| The Mustang/ | 2020-12-10 06:49 | - | |
| The Mysterious Note/ | 2021-04-14 18:59 | - | |
| The Mystery of Iron ..> | 2022-02-20 18:29 | - | |
| The Nest/ | 2022-02-20 18:29 | - | |
| The Odds/ | 2020-12-10 06:52 | - | |
| The Outsider/ | 2020-12-10 06:53 | - | |
| The Parts You Lose/ | 2022-02-20 18:29 | - | |
| The Passage El-Mamarr/ | 2020-12-10 10:02 | - | |
| The Peanut Butter Fa..> | 2022-02-20 18:28 | - | |
| The Perfect Date/ | 2022-02-20 18:28 | - | |
| The Possession Diaries/ | 2020-12-10 06:55 | - | |
| The Prodigy/ | 2020-12-10 06:56 | - | |
| The Professor/ | 2022-02-20 18:27 | - | |
| The Professor and th..> | 2020-12-10 06:58 | - | |
| The Red Sea Diving R..> | 2022-02-20 18:27 | - | |
| The Refuge/ | 2019-11-01 20:03 | - | |
| The Rise of Hero/ | 2020-12-10 07:00 | - | |
| The Rising Hawk/ | 2022-02-20 18:26 | - | |
| The Room/ | 2022-02-20 18:25 | - | |
| The Ruthless Delecti..> | 2020-12-10 07:06 | - | |
| The Secret Life of P..> | 2020-12-10 07:07 | - | |
| The Seven Swords/ | 2020-12-10 07:08 | - | |
| The Silence/ | 2020-12-10 07:09 | - | |
| The Son/ | 2020-12-10 07:11 | - | |
| The Spy/ | 2020-12-10 07:12 | - | |
| The Tale of Despereaux/ | 2022-02-20 18:25 | - | |
| The Tashkent Files/ | 2022-02-20 18:24 | - | |
| The Tomorrow Man/ | 2021-07-04 23:49 | - | |
| The Town Of The Evil/ | 2020-12-10 07:13 | - | |
| The True Don Quixote/ | 2020-12-10 07:15 | - | |
| The Two Popes/ | 2020-12-10 07:16 | - | |
| The Upside/ | 2022-02-20 18:24 | - | |
| The Viking War/ | 2022-01-04 21:40 | - | |
| The Wandering Earth/ | 2022-02-20 18:24 | - | |
| The Warden/ | 2020-12-10 07:18 | - | |
| The Warriors Way/ | 2020-12-10 07:19 | - | |
| The Wedding Guest/ | 2020-12-10 07:29 | - | |
| The Wheel/ | 2020-12-10 07:30 | - | |
| The White Storm 2_ D..> | 2020-12-10 07:30 | - | |
| The Wolfs Call/ | 2022-02-20 18:22 | - | |
| The fighting preacher/ | 2020-12-10 13:11 | - | |
| The lady improper/ | 2020-12-10 06:36 | - | |
| Them That Follow/ | 2022-02-20 18:20 | - | |
| The twisted son/ | 2020-12-10 07:15 | - | |
| Ti&Ti/ | 2020-12-10 07:46 | - | |
| Tigers Are Not Afraid/ | 2020-12-10 07:47 | - | |
| Togo/ | 2021-02-01 01:18 | - | |
| Tolkien/ | 2022-02-20 18:19 | - | |
| Tom Clancy's Jack Ryan/ | 2022-02-20 18:19 | - | |
| Top Boy/ | 2020-12-10 07:49 | - | |
| Top End Wedding/ | 2020-12-10 07:50 | - | |
| Toy Story 4/ | 2021-02-16 21:55 | - | |
| Trading Paint/ | 2022-02-20 18:18 | - | |
| Transit 17/ | 2020-12-10 07:51 | - | |
| Trapped The Alex Coo..> | 2020-02-10 16:11 | - | |
| Trauma Center/ | 2022-02-20 18:17 | - | |
| Triple Frontier/ | 2022-02-20 18:17 | - | |
| Triple Seat/ | 2022-02-20 18:17 | - | |
| Triple Threat/ | 2022-02-20 18:17 | - | |
| Trust No 1/ | 2021-03-20 16:45 | - | |
| Tubines/ | 2020-12-10 07:55 | - | |
| Turkey.Drop/ | 2019-12-05 17:18 | - | |
| Turkey Drop/ | 2020-12-10 07:55 | - | |
| UglyDolls/ | 2020-12-10 07:56 | - | |
| Uncut Gems/ | 2020-12-10 07:56 | - | |
| Unforgivable Sin/ | 2021-05-09 19:13 | - | |
| Untogether/ | 2020-12-10 07:57 | - | |
| Vares The Garter Snake/ | 2020-12-10 07:59 | - | |
| Velvet Buzzsaw/ | 2020-12-10 08:00 | - | |
| Verdict/ | 2022-02-20 18:15 | - | |
| Vernost/ | 2020-12-10 08:01 | - | |
| Vice/ | 2022-02-20 18:15 | - | |
| Villains/ | 2022-01-04 21:35 | - | |
| Virginia Minnesota/ | 2020-12-10 08:03 | - | |
| Volkov/ | 2020-12-10 08:03 | - | |
| We Die Young/ | 2022-02-20 18:14 | - | |
| We Used to Know Each..> | 2020-12-10 08:05 | - | |
| Welcome to Acapulco/ | 2020-12-10 08:05 | - | |
| White.Crow/ | 2022-02-20 18:14 | - | |
| White Snake/ | 2020-12-10 08:06 | - | |
| Wicked Witches/ | 2020-12-10 08:07 | - | |
| Wine Country/ | 2022-02-20 18:13 | - | |
| Wings Over Everest/ | 2020-12-10 08:08 | - | |
| Women Of Mafia 2/ | 2022-02-20 18:13 | - | |
| Wonder Park/ | 2022-02-20 18:12 | - | |
| World War Four/ | 2020-12-10 08:10 | - | |
| Wounds/ | 2020-12-24 17:57 | - | |
| X-Men Dark Phoenix/ | 2020-12-10 08:10 | - | |
| Xenophobia/ | 2020-12-10 08:11 | - | |
| Xin Feng Shen Jiang ..> | 2020-12-10 08:11 | - | |
| Yu Tian Wu Chang Zhuan/ | 2020-12-10 08:12 | - | |
| Zeroville/ | 2022-02-20 18:11 | - | |
| Zombie Tidal Wave/ | 2022-01-04 21:36 | - | |
| Zombieland Double Tap/ | 2022-02-20 18:12 | - | |
| Zoombies 2/ | 2020-12-10 08:13 | - | |
| artik/ | 2022-02-20 17:41 | - | |
| avengement/ | 2022-02-20 18:10 | - | |
| body at brighton rock/ | 2022-02-20 18:09 | - | |
| clown motel/ | 2020-12-10 02:27 | - | |
| dauntless the battle..> | 2020-12-10 02:39 | - | |
| depraved/ | 2020-12-10 02:42 | - | |
| finding steve mcqueen/ | 2022-02-20 18:09 | - | |
| hollow point/ | 2020-12-10 03:44 | - | |
| investigation/ | 2020-12-10 03:55 | - | |
| low tide/ | 2020-12-10 04:15 | - | |
| primal/ | 2020-12-10 05:07 | - | |
| shaft/ | 2020-12-10 05:37 | - | |
| the.haunting.of.la.l..> | 2020-12-10 07:34 | - | |
| the young cannibals/ | 2020-12-10 07:32 | - | |
| trick/ | 2022-02-20 18:08 | - | |
| vault/ | 2022-02-20 18:07 | - | |